| General Information | |
|---|---|
| ZINC ID | ZINC000000226102 |
| Molecular Weight (Da) | 258 |
| SMILES | Cc1cc(O)c2c(c1)OC(C)(C)C1=C2C[C@H](C)CC1 |
| Molecular Formula | C17O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 77.698 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 0 |
| Heavy Atoms | 19 |
| LogP | 4.522 |
| Activity (Ki) in nM | 660.693 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.73549538 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.53 |
| Ilogp | 3.34 |
| Xlogp3 | 3.59 |
| Wlogp | 4.45 |
| Mlogp | 3.47 |
| Silicos-it log p | 4.26 |
| Consensus log p | 3.82 |
| Esol log s | -3.94 |
| Esol solubility (mg/ml) | 0.0299 |
| Esol solubility (mol/l) | 0.000116 |
| Esol class | Soluble |
| Ali log s | -3.9 |
| Ali solubility (mg/ml) | 0.0329 |
| Ali solubility (mol/l) | 0.000127 |
| Ali class | Soluble |
| Silicos-it logsw | -4.78 |
| Silicos-it solubility (mg/ml) | 0.00426 |
| Silicos-it solubility (mol/l) | 0.0000165 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.33 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.88 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.439 |
| Logd | 4.421 |
| Logp | 5.355 |
| F (20%) | 0.9 |
| F (30%) | 0.554 |
| Mdck | 1.94E-05 |
| Ppb | 0.9871 |
| Vdss | 3.868 |
| Fu | 0.0255 |
| Cyp1a2-inh | 0.965 |
| Cyp1a2-sub | 0.841 |
| Cyp2c19-inh | 0.856 |
| Cyp2c19-sub | 0.485 |
| Cl | 6.913 |
| T12 | 0.177 |
| H-ht | 0.748 |
| Dili | 0.867 |
| Roa | 0.227 |
| Fdamdd | 0.651 |
| Skinsen | 0.395 |
| Ec | 0.003 |
| Ei | 0.04 |
| Respiratory | 0.953 |
| Bcf | 1.032 |
| Igc50 | 4.321 |
| Lc50 | 5.163 |
| Lc50dm | 4.581 |
| Nr-ar | 0.175 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.722 |
| Nr-aromatase | 0.139 |
| Nr-er | 0.091 |
| Nr-er-lbd | 0.022 |
| Nr-ppar-gamma | 0.501 |
| Sr-are | 0.083 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.399 |
| Sr-mmp | 0.679 |
| Sr-p53 | 0.083 |
| Vol | 283.953 |
| Dense | 0.909 |
| Flex | 0 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.745 |
| Synth | 3.315 |
| Fsp3 | 0.529 |
| Mce-18 | 64.308 |
| Natural product-likeness | 1.481 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |