| General Information | |
|---|---|
| ZINC ID | ZINC000000866124 |
| Molecular Weight (Da) | 437 |
| SMILES | O=C(NCc1ccccc1)c1ccc(Br)c(S(=O)(=O)N2CCCCC2)c1 |
| Molecular Formula | C19Br1N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.863 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| LogP | 3.404 |
| Activity (Ki) in nM | 1096.48 |
| Polar Surface Area (PSA) | 74.86 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.97136259 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.32 |
| Ilogp | 2.93 |
| Xlogp3 | 3.38 |
| Wlogp | 4.1 |
| Mlogp | 2.81 |
| Silicos-it log p | 3.05 |
| Consensus log p | 3.25 |
| Esol log s | -4.63 |
| Esol solubility (mg/ml) | 0.0103 |
| Esol solubility (mol/l) | 0.0000236 |
| Esol class | Moderately |
| Ali log s | -4.63 |
| Ali solubility (mg/ml) | 0.0102 |
| Ali solubility (mol/l) | 0.0000234 |
| Ali class | Moderately |
| Silicos-it logsw | -6.71 |
| Silicos-it solubility (mg/ml) | 0.0000855 |
| Silicos-it solubility (mol/l) | 0.00000019 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.57 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.83 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.621 |
| Logd | 3.264 |
| Logp | 3.736 |
| F (20%) | 0.002 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 97.79% |
| Vdss | 0.684 |
| Fu | 2.00% |
| Cyp1a2-inh | 0.575 |
| Cyp1a2-sub | 0.162 |
| Cyp2c19-inh | 0.885 |
| Cyp2c19-sub | 0.365 |
| Cl | 1.943 |
| T12 | 0.217 |
| H-ht | 0.46 |
| Dili | 0.97 |
| Roa | 0.3 |
| Fdamdd | 0.893 |
| Skinsen | 0.042 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.043 |
| Bcf | 0.657 |
| Igc50 | 4.444 |
| Lc50 | 5.161 |
| Lc50dm | 5.053 |
| Nr-ar | 0.053 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.362 |
| Nr-aromatase | 0.592 |
| Nr-er | 0.231 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.012 |
| Sr-are | 0.444 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.012 |
| Sr-mmp | 0.784 |
| Sr-p53 | 0.013 |
| Vol | 379.212 |
| Dense | 1.15 |
| Flex | 0.286 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.778 |
| Synth | 1.893 |
| Fsp3 | 0.316 |
| Mce-18 | 43.2 |
| Natural product-likeness | -1.883 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |