| General Information | |
|---|---|
| ZINC ID | ZINC000001530833 |
| Molecular Weight (Da) | 310 |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)c1ccc(C)cc1-2 |
| Molecular Formula | C21O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 95.448 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| LogP | 6.198 |
| Activity (Ki) in nM | 95.499 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13818168 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.94 |
| Xlogp3 | 6.11 |
| Wlogp | 5.62 |
| Mlogp | 4.23 |
| Silicos-it log p | 6.15 |
| Consensus log p | 5.21 |
| Esol log s | -5.74 |
| Esol solubility (mg/ml) | 0.00057 |
| Esol solubility (mol/l) | 0.00000184 |
| Esol class | Moderately |
| Ali log s | -6.51 |
| Ali solubility (mg/ml) | 0.0000959 |
| Ali solubility (mol/l) | 0.0000003 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.49 |
| Silicos-it solubility (mg/ml) | 0.00001 |
| Silicos-it solubility (mol/l) | 3.22E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.86 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.39 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.181 |
| Logd | 4.616 |
| Logp | 6.681 |
| F (20%) | 0.975 |
| F (30%) | 0.987 |
| Mdck | 1.28E-05 |
| Ppb | 0.9964 |
| Vdss | 2.688 |
| Fu | 0.0103 |
| Cyp1a2-inh | 0.792 |
| Cyp1a2-sub | 0.791 |
| Cyp2c19-inh | 0.886 |
| Cyp2c19-sub | 0.162 |
| Cl | 4.029 |
| T12 | 0.07 |
| H-ht | 0.456 |
| Dili | 0.86 |
| Roa | 0.055 |
| Fdamdd | 0.631 |
| Skinsen | 0.113 |
| Ec | 0.003 |
| Ei | 0.475 |
| Respiratory | 0.371 |
| Bcf | 3.094 |
| Igc50 | 5.154 |
| Lc50 | 6.136 |
| Lc50dm | 5.888 |
| Nr-ar | 0.114 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.85 |
| Nr-aromatase | 0.749 |
| Nr-er | 0.552 |
| Nr-er-lbd | 0.678 |
| Nr-ppar-gamma | 0.92 |
| Sr-are | 0.862 |
| Sr-atad5 | 0.016 |
| Sr-hse | 0.777 |
| Sr-mmp | 0.958 |
| Sr-p53 | 0.7 |
| Vol | 347.864 |
| Dense | 0.892 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.731 |
| Synth | 2.464 |
| Fsp3 | 0.429 |
| Mce-18 | 39.267 |
| Natural product-likeness | 1.194 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |