| General Information | |
|---|---|
| ZINC ID | ZINC000001554195 |
| Molecular Weight (Da) | 499 |
| SMILES | CCCCCc1ccc(-c2c(C)c(C(=O)NN3CCCCC3)nn2-c2ccc(Cl)cc2Cl)cc1 |
| Molecular Formula | C27Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.597 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| LogP | 8.328 |
| Activity (Ki) in nM | 1 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.083 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.41 |
| Ilogp | 5.27 |
| Xlogp3 | 8.28 |
| Wlogp | 6.64 |
| Mlogp | 5.61 |
| Silicos-it log p | 6.54 |
| Consensus log p | 6.47 |
| Esol log s | -7.93 |
| Esol solubility (mg/ml) | 0.00000588 |
| Esol solubility (mol/l) | 1.18E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.2 |
| Ali solubility (mg/ml) | 0.00000031 |
| Ali solubility (mol/l) | 6.36E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.62 |
| Silicos-it solubility (mg/ml) | 0.00000012 |
| Silicos-it solubility (mol/l) | 2.42E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.47 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.96 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.853 |
| Logd | 5.641 |
| Logp | 7.041 |
| F (20%) | 0.003 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 99.93% |
| Vdss | 1.84 |
| Fu | 1.37% |
| Cyp1a2-inh | 0.092 |
| Cyp1a2-sub | 0.88 |
| Cyp2c19-inh | 0.871 |
| Cyp2c19-sub | 0.751 |
| Cl | 6.503 |
| T12 | 0.019 |
| H-ht | 0.715 |
| Dili | 0.951 |
| Roa | 0.725 |
| Fdamdd | 0.548 |
| Skinsen | 0.074 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.705 |
| Bcf | 2.083 |
| Igc50 | 5.375 |
| Lc50 | 6.248 |
| Lc50dm | 6.196 |
| Nr-ar | 0.023 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.753 |
| Nr-aromatase | 0.909 |
| Nr-er | 0.78 |
| Nr-er-lbd | 0.118 |
| Nr-ppar-gamma | 0.756 |
| Sr-are | 0.924 |
| Sr-atad5 | 0.069 |
| Sr-hse | 0.671 |
| Sr-mmp | 0.958 |
| Sr-p53 | 0.935 |
| Vol | 500.793 |
| Dense | 0.995 |
| Flex | 0.375 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.339 |
| Synth | 2.513 |
| Fsp3 | 0.407 |
| Mce-18 | 52.053 |
| Natural product-likeness | -1.101 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |