| General Information | |
|---|---|
| ZINC ID | ZINC000003048070 |
| Molecular Weight (Da) | 469 |
| SMILES | CCN(Cc1ccccc1)C(=O)c1oc2ccc(S(=O)(=O)N3C[C@H](C)C[C@@H](C)C3)cc2c1C |
| Molecular Formula | C26N2O4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.22 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| LogP | 4.84 |
| Activity (Ki) in nM | 3090.295 |
| Polar Surface Area (PSA) | 79.21 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08105289 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.03 |
| Xlogp3 | 5.21 |
| Wlogp | 5.62 |
| Mlogp | 3.02 |
| Silicos-it log p | 3.88 |
| Consensus log p | 4.35 |
| Esol log s | -5.9 |
| Esol solubility (mg/ml) | 0.000587 |
| Esol solubility (mol/l) | 0.00000125 |
| Esol class | Moderately |
| Ali log s | -6.62 |
| Ali solubility (mg/ml) | 0.000112 |
| Ali solubility (mol/l) | 0.00000023 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.49 |
| Silicos-it solubility (mg/ml) | 0.0000151 |
| Silicos-it solubility (mol/l) | 3.22E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.46 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.57 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.76 |
| Logd | 4.375 |
| Logp | 5.297 |
| F (20%) | 0.004 |
| F (30%) | 0.004 |
| Mdck | 2.79E-05 |
| Ppb | 0.9983 |
| Vdss | 0.766 |
| Fu | 0.0152 |
| Cyp1a2-inh | 0.546 |
| Cyp1a2-sub | 0.718 |
| Cyp2c19-inh | 0.963 |
| Cyp2c19-sub | 0.488 |
| Cl | 6.349 |
| T12 | 0.064 |
| H-ht | 0.994 |
| Dili | 0.994 |
| Roa | 0.219 |
| Fdamdd | 0.72 |
| Skinsen | 0.06 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.03 |
| Bcf | 1.396 |
| Igc50 | 4.492 |
| Lc50 | 5.799 |
| Lc50dm | 4.15 |
| Nr-ar | 0.013 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.307 |
| Nr-aromatase | 0.741 |
| Nr-er | 0.114 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.011 |
| Sr-are | 0.581 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.024 |
| Sr-mmp | 0.569 |
| Sr-p53 | 0.007 |
| Vol | 478.598 |
| Dense | 0.978 |
| Flex | 0.28 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.506 |
| Synth | 3.135 |
| Fsp3 | 0.423 |
| Mce-18 | 85.027 |
| Natural product-likeness | -1.579 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |