| General Information | |
|---|---|
| ZINC ID | ZINC000003483340 |
| Molecular Weight (Da) | 393 |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2Cl)cc1S(=O)(=O)N1CCCCC1 |
| Molecular Formula | C19Cl1N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.251 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| LogP | 3.799 |
| Activity (Ki) in nM | 5.012 |
| Polar Surface Area (PSA) | 74.86 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 1.07559287 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.32 |
| Ilogp | 2.91 |
| Xlogp3 | 3.74 |
| Wlogp | 4.58 |
| Mlogp | 2.96 |
| Silicos-it log p | 3.14 |
| Consensus log p | 3.47 |
| Esol log s | -4.64 |
| Esol solubility (mg/ml) | 8.92E-03 |
| Esol solubility (mol/l) | 2.27E-05 |
| Esol class | Moderately |
| Ali log s | -5 |
| Ali solubility (mg/ml) | 3.89E-03 |
| Ali solubility (mol/l) | 9.90E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -6.5 |
| Silicos-it solubility (mg/ml) | 1.26E-04 |
| Silicos-it solubility (mol/l) | 3.20E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.04 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.514 |
| Logd | 3.602 |
| Logp | 4.247 |
| F (20%) | 0.004 |
| F (30%) | 0.026 |
| Mdck | 1.93E-05 |
| Ppb | 0.9834 |
| Vdss | 0.52 |
| Fu | 0.0146 |
| Cyp1a2-inh | 0.37 |
| Cyp1a2-sub | 0.923 |
| Cyp2c19-inh | 0.804 |
| Cyp2c19-sub | 0.42 |
| Cl | 2.05 |
| T12 | 0.157 |
| H-ht | 0.831 |
| Dili | 0.984 |
| Roa | 0.361 |
| Fdamdd | 0.852 |
| Skinsen | 0.044 |
| Ec | 0.003 |
| Ei | 0.047 |
| Respiratory | 0.07 |
| Bcf | 1.149 |
| Igc50 | 4.535 |
| Lc50 | 5.393 |
| Lc50dm | 4.862 |
| Nr-ar | 0.039 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.758 |
| Nr-aromatase | 0.933 |
| Nr-er | 0.293 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.165 |
| Sr-are | 0.714 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.032 |
| Sr-mmp | 0.922 |
| Sr-p53 | 0.23 |
| Vol | 375.14 |
| Dense | 1.045 |
| Flex | 21 |
| Nstereo | 0.238 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.852 |
| Fsp3 | 1.847 |
| Mce-18 | 0.316 |
| Natural product-likeness | 45.6 |
| Alarm nmr | -2.274 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |