| General Information | |
|---|---|
| ZINC ID | ZINC000003947921 |
| Molecular Weight (Da) | 390 |
| SMILES | O=C(NCc1ccccc1)c1cnc(Nc2cccc(F)c2)nc1C(F)(F)F |
| Molecular Formula | C19F4N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 95.063 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 4.49 |
| Activity (Ki) in nM | 309.03 |
| Polar Surface Area (PSA) | 66.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13133454 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.11 |
| Ilogp | 2.77 |
| Xlogp3 | 3.87 |
| Wlogp | 5.73 |
| Mlogp | 3.11 |
| Silicos-it log p | 4.14 |
| Consensus log p | 3.92 |
| Esol log s | -4.71 |
| Esol solubility (mg/ml) | 7.58E-03 |
| Esol solubility (mol/l) | 1.94E-05 |
| Esol class | Moderately |
| Ali log s | -4.97 |
| Ali solubility (mg/ml) | 4.16E-03 |
| Ali solubility (mol/l) | 1.07E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -8.24 |
| Silicos-it solubility (mg/ml) | 2.25E-06 |
| Silicos-it solubility (mol/l) | 5.77E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.93 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.65 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.527 |
| Logd | 3.838 |
| Logp | 3.87 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 2.10E-05 |
| Ppb | 0.979 |
| Vdss | 1.512 |
| Fu | 0.0144 |
| Cyp1a2-inh | 0.79 |
| Cyp1a2-sub | 0.502 |
| Cyp2c19-inh | 0.941 |
| Cyp2c19-sub | 0.06 |
| Cl | 4.893 |
| T12 | 0.252 |
| H-ht | 0.989 |
| Dili | 0.836 |
| Roa | 0.605 |
| Fdamdd | 0.955 |
| Skinsen | 0.382 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.907 |
| Bcf | 1.157 |
| Igc50 | 3.404 |
| Lc50 | 4.752 |
| Lc50dm | 6.939 |
| Nr-ar | 0.046 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.902 |
| Nr-aromatase | 0.879 |
| Nr-er | 0.197 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.056 |
| Sr-are | 0.351 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.012 |
| Sr-mmp | 0.524 |
| Sr-p53 | 0.205 |
| Vol | 362.194 |
| Dense | 1.077 |
| Flex | 20 |
| Nstereo | 0.3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 3 |
| Qed | 1 |
| Synth | 0.667 |
| Fsp3 | 2.707 |
| Mce-18 | 0.105 |
| Natural product-likeness | 19 |
| Alarm nmr | -1.539 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |