| General Information | |
|---|---|
| ZINC ID | ZINC000005701460 |
| Molecular Weight (Da) | 410 |
| SMILES | Cc1ccc(C(=O)Nc2ccc3ccccc3n2)cc1S(=O)(=O)N1CCCCC1 |
| Molecular Formula | C22N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.681 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 3.863 |
| Activity (Ki) in nM | 194.984 |
| Polar Surface Area (PSA) | 87.75 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13083779 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.27 |
| Ilogp | 3.1 |
| Xlogp3 | 3.72 |
| Wlogp | 4.48 |
| Mlogp | 2.82 |
| Silicos-it log p | 2.97 |
| Consensus log p | 3.42 |
| Esol log s | -4.8 |
| Esol solubility (mg/ml) | 6.48E-03 |
| Esol solubility (mol/l) | 1.58E-05 |
| Esol class | Moderately |
| Ali log s | -5.25 |
| Ali solubility (mg/ml) | 2.28E-03 |
| Ali solubility (mol/l) | 5.57E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.17 |
| Silicos-it solubility (mg/ml) | 2.78E-05 |
| Silicos-it solubility (mol/l) | 6.79E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.16 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.95 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.353 |
| Logd | 3.687 |
| Logp | 4.119 |
| F (20%) | 0.005 |
| F (30%) | 0.004 |
| Mdck | 2.18E-05 |
| Ppb | 0.9751 |
| Vdss | 0.54 |
| Fu | 0.0228 |
| Cyp1a2-inh | 0.484 |
| Cyp1a2-sub | 0.823 |
| Cyp2c19-inh | 0.832 |
| Cyp2c19-sub | 0.109 |
| Cl | 2.526 |
| T12 | 0.153 |
| H-ht | 0.976 |
| Dili | 0.987 |
| Roa | 0.836 |
| Fdamdd | 0.942 |
| Skinsen | 0.023 |
| Ec | 0.003 |
| Ei | 0.032 |
| Respiratory | 0.914 |
| Bcf | 0.736 |
| Igc50 | 4.421 |
| Lc50 | 5.34 |
| Lc50dm | 5.304 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.636 |
| Nr-aromatase | 0.941 |
| Nr-er | 0.451 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.028 |
| Sr-are | 0.773 |
| Sr-atad5 | 0.07 |
| Sr-hse | 0.06 |
| Sr-mmp | 0.879 |
| Sr-p53 | 0.374 |
| Vol | 408.984 |
| Dense | 1 |
| Flex | 27 |
| Nstereo | 0.148 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.72 |
| Fsp3 | 2.583 |
| Mce-18 | 0.273 |
| Natural product-likeness | 54.214 |
| Alarm nmr | -1.646 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |