| General Information | |
|---|---|
| ZINC ID | ZINC000007690168 |
| Molecular Weight (Da) | 405 |
| SMILES | Cc1ccc(C(=O)N2CC[C@@H]3CCCC[C@@H]3C2)cc1S(=O)(=O)N1CCCCC1 |
| Molecular Formula | C22N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.127 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| LogP | 3.794 |
| Activity (Ki) in nM | 1.514 |
| Polar Surface Area (PSA) | 66.07 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.7558217 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 3.81 |
| Xlogp3 | 4.14 |
| Wlogp | 4.14 |
| Mlogp | 3.1 |
| Silicos-it log p | 2.81 |
| Consensus log p | 3.6 |
| Esol log s | -4.85 |
| Esol solubility (mg/ml) | 5.70E-03 |
| Esol solubility (mol/l) | 1.41E-05 |
| Esol class | Moderately |
| Ali log s | -5.23 |
| Ali solubility (mg/ml) | 2.36E-03 |
| Ali solubility (mol/l) | 5.82E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -4.67 |
| Silicos-it solubility (mg/ml) | 8.59E-03 |
| Silicos-it solubility (mol/l) | 2.12E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.83 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.92 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.341 |
| Logd | 3.87 |
| Logp | 4.752 |
| F (20%) | 0.993 |
| F (30%) | 0.079 |
| Mdck | 1.37E-05 |
| Ppb | 0.958 |
| Vdss | 1.205 |
| Fu | 0.0459 |
| Cyp1a2-inh | 0.274 |
| Cyp1a2-sub | 0.95 |
| Cyp2c19-inh | 0.785 |
| Cyp2c19-sub | 0.834 |
| Cl | 3.481 |
| T12 | 0.062 |
| H-ht | 0.599 |
| Dili | 0.947 |
| Roa | 0.038 |
| Fdamdd | 0.256 |
| Skinsen | 0.242 |
| Ec | 0.003 |
| Ei | 0.054 |
| Respiratory | 0.788 |
| Bcf | 0.74 |
| Igc50 | 4.4 |
| Lc50 | 4.767 |
| Lc50dm | 3.804 |
| Nr-ar | 0.023 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.057 |
| Nr-aromatase | 0.852 |
| Nr-er | 0.237 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.617 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.52 |
| Sr-mmp | 0.849 |
| Sr-p53 | 0.012 |
| Vol | 411.17 |
| Dense | 0.983 |
| Flex | 26 |
| Nstereo | 0.154 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.769 |
| Fsp3 | 2.878 |
| Mce-18 | 0.682 |
| Natural product-likeness | 86.405 |
| Alarm nmr | -1.642 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |