| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000009510931 |
| Molecular Weight (Da) | 459 |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccccc1C(=O)Nc1ccc(Br)cc1 |
| Molecular Formula | C24Br1N2O2 |
| Action | Inverse Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000009510931 |
| Molecular Weight (Da) | 459 |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccccc1C(=O)Nc1ccc(Br)cc1 |
| Molecular Formula | C24Br1N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000009510931 |
| Molar Refractivity | 122.258 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| LogP | 6.347 |
| Activity (Ki) in nM | 25.119 |
| Polar Surface Area (PSA) | 49.41 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000009510931 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08367753 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.23 |
| Xlogp3 | 7.36 |
| Wlogp | 6.33 |
| Mlogp | 5.03 |
| Silicos-it log p | 6.03 |
| Consensus log p | 5.8 |
| Esol log s | -6.77 |
| Esol solubility (mg/ml) | 7.74E-05 |
| Esol solubility (mol/l) | 1.68E-07 |
| Esol class | Poorly sol |
| Ali log s | -8.23 |
| Ali solubility (mg/ml) | 2.73E-06 |
| Ali solubility (mol/l) | 5.94E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.93 |
| Silicos-it solubility (mg/ml) | 5.40E-07 |
| Silicos-it solubility (mol/l) | 1.17E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.88 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 2.76 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.884 |
| Logd | 4.368 |
| Logp | 6.514 |
| F (20%) | 0.003 |
| F (30%) | 0.285 |
| Mdck | 1.39E-05 |
| Ppb | 0.9825 |
| Vdss | 0.771 |
| Fu | 0.0158 |
| Cyp1a2-inh | 0.272 |
| Cyp1a2-sub | 0.407 |
| Cyp2c19-inh | 0.84 |
| Cyp2c19-sub | 0.121 |
| Cl | 2.264 |
| T12 | 0.061 |
| H-ht | 0.166 |
| Dili | 0.858 |
| Roa | 0.519 |
| Fdamdd | 0.041 |
| Skinsen | 0.646 |
| Ec | 0.004 |
| Ei | 0.29 |
| Respiratory | 0.047 |
| Bcf | 1.433 |
| Igc50 | 5.095 |
| Lc50 | 5.544 |
| Lc50dm | 5.491 |
| Nr-ar | 0.62 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.602 |
| Nr-aromatase | 0.73 |
| Nr-er | 0.295 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.151 |
| Sr-are | 0.438 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.176 |
| Sr-mmp | 0.882 |
| Sr-p53 | 0.147 |
| Vol | 444.313 |
| Dense | 1.031 |
| Flex | 14 |
| Nstereo | 0.929 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.389 |
| Fsp3 | 2.008 |
| Mce-18 | 0.417 |
| Natural product-likeness | 13 |
| Alarm nmr | -1.21 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |