| General Information | |
|---|---|
| ZINC ID | ZINC000009673171 |
| Molecular Weight (Da) | 441 |
| SMILES | Cc1c(C(=O)NCc2ccccc2)oc2ccc(S(=O)(=O)N3C[C@H](C)C[C@@H](C)C3)cc12 |
| Molecular Formula | C24N2O4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.575 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 4.285 |
| Activity (Ki) in nM | 6606.934 |
| Polar Surface Area (PSA) | 88 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.029 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.03 |
| Xlogp3 | 4.66 |
| Wlogp | 4.89 |
| Mlogp | 2.6 |
| Silicos-it log p | 3.52 |
| Consensus log p | 3.94 |
| Esol log s | -5.47 |
| Esol solubility (mg/ml) | 0.0015 |
| Esol solubility (mol/l) | 0.00000339 |
| Esol class | Moderately |
| Ali log s | -6.23 |
| Ali solubility (mg/ml) | 0.000257 |
| Ali solubility (mol/l) | 0.00000058 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.44 |
| Silicos-it solubility (mg/ml) | 0.0000158 |
| Silicos-it solubility (mol/l) | 0.00000003 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.68 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.33 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.162 |
| Logd | 4.264 |
| Logp | 5.036 |
| F (20%) | 0.003 |
| F (30%) | 0.024 |
| Mdck | 1.98E-05 |
| Ppb | 0.9963 |
| Vdss | 0.811 |
| Fu | 0.0139 |
| Cyp1a2-inh | 0.668 |
| Cyp1a2-sub | 0.271 |
| Cyp2c19-inh | 0.962 |
| Cyp2c19-sub | 0.614 |
| Cl | 5.866 |
| T12 | 0.089 |
| H-ht | 0.993 |
| Dili | 0.994 |
| Roa | 0.328 |
| Fdamdd | 0.908 |
| Skinsen | 0.12 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.032 |
| Bcf | 1.293 |
| Igc50 | 4.514 |
| Lc50 | 5.798 |
| Lc50dm | 4.449 |
| Nr-ar | 0.014 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.417 |
| Nr-aromatase | 0.527 |
| Nr-er | 0.121 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.011 |
| Sr-are | 0.614 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.022 |
| Sr-mmp | 0.676 |
| Sr-p53 | 0.01 |
| Vol | 444.006 |
| Dense | 0.991 |
| Flex | 0.24 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.64 |
| Synth | 2.982 |
| Fsp3 | 0.375 |
| Mce-18 | 82.576 |
| Natural product-likeness | -1.506 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |