| General Information | |
|---|---|
| ZINC ID | ZINC000013472852 |
| Molecular Weight (Da) | 521 |
| SMILES | Cc1c(C(=O)N(C)C2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Br)cc1 |
| Molecular Formula | C24Br1Cl2N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.949 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 7.797 |
| Activity (Ki) in nM | 1258.925 |
| Polar Surface Area (PSA) | 38.13 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.197 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.5 |
| Xlogp3 | 7.47 |
| Wlogp | 7.32 |
| Mlogp | 5.6 |
| Silicos-it log p | 6.17 |
| Consensus log p | 6.21 |
| Esol log s | -7.85 |
| Esol solubility (mg/ml) | 0.0000073 |
| Esol solubility (mol/l) | 0.00000001 |
| Esol class | Poorly sol |
| Ali log s | -8.1 |
| Ali solubility (mg/ml) | 0.00000411 |
| Ali solubility (mol/l) | 7.88E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.82 |
| Silicos-it solubility (mg/ml) | 0.00000078 |
| Silicos-it solubility (mol/l) | 1.51E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.18 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.379 |
| Logd | 4.795 |
| Logp | 6.802 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 7.72E-06 |
| Ppb | 0.9789 |
| Vdss | 1.223 |
| Fu | 0.0219 |
| Cyp1a2-inh | 0.213 |
| Cyp1a2-sub | 0.805 |
| Cyp2c19-inh | 0.867 |
| Cyp2c19-sub | 0.818 |
| Cl | 2.723 |
| T12 | 0.016 |
| H-ht | 0.313 |
| Dili | 0.953 |
| Roa | 0.918 |
| Fdamdd | 0.273 |
| Skinsen | 0.089 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.041 |
| Bcf | 3.493 |
| Igc50 | 5.404 |
| Lc50 | 6.602 |
| Lc50dm | 6.325 |
| Nr-ar | 0.054 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.48 |
| Nr-aromatase | 0.829 |
| Nr-er | 0.75 |
| Nr-er-lbd | 0.028 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.85 |
| Sr-atad5 | 0.086 |
| Sr-hse | 0.04 |
| Sr-mmp | 0.918 |
| Sr-p53 | 0.912 |
| Vol | 457.192 |
| Dense | 1.135 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.361 |
| Synth | 2.472 |
| Fsp3 | 0.333 |
| Mce-18 | 57 |
| Natural product-likeness | -1.501 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |