| General Information | |
|---|---|
| ZINC ID | ZINC000013474257 |
| Molecular Weight (Da) | 465 |
| SMILES | CCCCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| Molecular Formula | C23Cl3N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.296 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| LogP | 7.89 |
| Activity (Ki) in nM | 6918.31 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 5.06 |
| Xlogp3 | 7.75 |
| Wlogp | 7.12 |
| Mlogp | 5.3 |
| Silicos-it log p | 7 |
| Consensus log p | 6.45 |
| Esol log s | -7.43 |
| Esol solubility (mg/ml) | 0.0000173 |
| Esol solubility (mol/l) | 3.72E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.58 |
| Ali solubility (mg/ml) | 0.00000123 |
| Ali solubility (mol/l) | 2.64E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.95 |
| Silicos-it solubility (mg/ml) | 0.00000005 |
| Silicos-it solubility (mol/l) | 1.12E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.63 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.33 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.096 |
| Logd | 5.027 |
| Logp | 7.11 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | 5.06E-06 |
| Ppb | 0.9944 |
| Vdss | 1.775 |
| Fu | 0.0185 |
| Cyp1a2-inh | 0.321 |
| Cyp1a2-sub | 0.509 |
| Cyp2c19-inh | 0.904 |
| Cyp2c19-sub | 0.152 |
| Cl | 5.068 |
| T12 | 0.029 |
| H-ht | 0.208 |
| Dili | 0.95 |
| Roa | 0.219 |
| Fdamdd | 0.469 |
| Skinsen | 0.127 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.055 |
| Bcf | 3.31 |
| Igc50 | 5.393 |
| Lc50 | 6.484 |
| Lc50dm | 6.16 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.888 |
| Nr-aromatase | 0.868 |
| Nr-er | 0.794 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.244 |
| Sr-are | 0.91 |
| Sr-atad5 | 0.374 |
| Sr-hse | 0.454 |
| Sr-mmp | 0.926 |
| Sr-p53 | 0.942 |
| Vol | 444.38 |
| Dense | 1.042 |
| Flex | 0.5 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.361 |
| Synth | 2.226 |
| Fsp3 | 0.304 |
| Mce-18 | 19 |
| Natural product-likeness | -1.226 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |