| General Information | |
|---|---|
| ZINC ID | ZINC000013474258 |
| Molecular Weight (Da) | 463 |
| SMILES | Cc1c(C(=O)NC2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C23Cl3N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.234 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 7.507 |
| Activity (Ki) in nM | 229.087 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.082 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.7 |
| Xlogp3 | 7.22 |
| Wlogp | 6.87 |
| Mlogp | 5.3 |
| Silicos-it log p | 6.18 |
| Consensus log p | 6.06 |
| Esol log s | -7.35 |
| Esol solubility (mg/ml) | 0.0000208 |
| Esol solubility (mol/l) | 4.49E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.03 |
| Ali solubility (mg/ml) | 0.00000433 |
| Ali solubility (mol/l) | 9.36E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.98 |
| Silicos-it solubility (mg/ml) | 0.00000048 |
| Silicos-it solubility (mol/l) | 1.05E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.26 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.227 |
| Logd | 4.94 |
| Logp | 6.713 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | 6.18E-06 |
| Ppb | 0.9932 |
| Vdss | 1.829 |
| Fu | 0.0164 |
| Cyp1a2-inh | 0.279 |
| Cyp1a2-sub | 0.36 |
| Cyp2c19-inh | 0.872 |
| Cyp2c19-sub | 0.137 |
| Cl | 3.784 |
| T12 | 0.018 |
| H-ht | 0.36 |
| Dili | 0.943 |
| Roa | 0.752 |
| Fdamdd | 0.713 |
| Skinsen | 0.102 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.123 |
| Bcf | 2.953 |
| Igc50 | 5.248 |
| Lc50 | 6.187 |
| Lc50dm | 6.073 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.853 |
| Nr-aromatase | 0.856 |
| Nr-er | 0.749 |
| Nr-er-lbd | 0.034 |
| Nr-ppar-gamma | 0.805 |
| Sr-are | 0.92 |
| Sr-atad5 | 0.367 |
| Sr-hse | 0.597 |
| Sr-mmp | 0.949 |
| Sr-p53 | 0.958 |
| Vol | 435.824 |
| Dense | 1.058 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.46 |
| Synth | 2.258 |
| Fsp3 | 0.304 |
| Mce-18 | 55.2 |
| Natural product-likeness | -1.346 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |