| General Information | |
|---|---|
| ZINC ID | ZINC000013474262 |
| Molecular Weight (Da) | 439 |
| SMILES | Cc1c(C(=O)NCCCO)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C20Cl3N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.379 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 5.172 |
| Activity (Ki) in nM | 1258.925 |
| Polar Surface Area (PSA) | 67.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.97809326 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.2 |
| Ilogp | 3.94 |
| Xlogp3 | 5.09 |
| Wlogp | 4.92 |
| Mlogp | 3.85 |
| Silicos-it log p | 5.2 |
| Consensus log p | 4.6 |
| Esol log s | -5.75 |
| Esol solubility (mg/ml) | 0.000773 |
| Esol solubility (mol/l) | 0.00000176 |
| Esol class | Moderately |
| Ali log s | -6.24 |
| Ali solubility (mg/ml) | 0.000251 |
| Ali solubility (mol/l) | 0.00000057 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.21 |
| Silicos-it solubility (mg/ml) | 0.00000274 |
| Silicos-it solubility (mol/l) | 6.24E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.36 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.584 |
| Logd | 3.837 |
| Logp | 4.664 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 7.00E-06 |
| Ppb | 0.9783 |
| Vdss | 0.856 |
| Fu | 0.0246 |
| Cyp1a2-inh | 0.635 |
| Cyp1a2-sub | 0.207 |
| Cyp2c19-inh | 0.934 |
| Cyp2c19-sub | 0.194 |
| Cl | 7.639 |
| T12 | 0.115 |
| H-ht | 0.364 |
| Dili | 0.958 |
| Roa | 0.521 |
| Fdamdd | 0.258 |
| Skinsen | 0.08 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.033 |
| Bcf | 1.954 |
| Igc50 | 4.777 |
| Lc50 | 5.799 |
| Lc50dm | 5.664 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.931 |
| Nr-aromatase | 0.924 |
| Nr-er | 0.626 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.24 |
| Sr-are | 0.873 |
| Sr-atad5 | 0.371 |
| Sr-hse | 0.439 |
| Sr-mmp | 0.86 |
| Sr-p53 | 0.951 |
| Vol | 401.283 |
| Dense | 1.089 |
| Flex | 0.389 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.537 |
| Synth | 2.254 |
| Fsp3 | 0.2 |
| Mce-18 | 19 |
| Natural product-likeness | -1.265 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |