| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013474265 |
| Molecular Weight (Da) | 439 |
| SMILES | Cc1c(C(=O)N[C@H](C)CO)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C20Cl3N3O2 |
| Action | Antagonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013474265 |
| Molecular Weight (Da) | 439 |
| SMILES | Cc1c(C(=O)N[C@H](C)CO)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C20Cl3N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013474265 |
| Molar Refractivity | 112.931 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 5.487 |
| Activity (Ki) in nM | 1778.279 |
| Polar Surface Area (PSA) | 67.15 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013474265 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.71719747 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.2 |
| Ilogp | 3.93 |
| Xlogp3 | 5.16 |
| Wlogp | 4.92 |
| Mlogp | 3.85 |
| Silicos-it log p | 5.03 |
| Consensus log p | 4.58 |
| Esol log s | -5.86 |
| Esol solubility (mg/ml) | 0.0006 |
| Esol solubility (mol/l) | 0.00000137 |
| Esol class | Moderately |
| Ali log s | -6.32 |
| Ali solubility (mg/ml) | 0.000212 |
| Ali solubility (mol/l) | 0.00000048 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.83 |
| Silicos-it solubility (mg/ml) | 0.00000646 |
| Silicos-it solubility (mol/l) | 1.47E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.31 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.54 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.51 |
| Logd | 4.203 |
| Logp | 5.151 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 7.95E-06 |
| Ppb | 0.9885 |
| Vdss | 1.414 |
| Fu | 0.0182 |
| Cyp1a2-inh | 0.53 |
| Cyp1a2-sub | 0.264 |
| Cyp2c19-inh | 0.918 |
| Cyp2c19-sub | 0.221 |
| Cl | 4.405 |
| T12 | 0.083 |
| H-ht | 0.762 |
| Dili | 0.97 |
| Roa | 0.437 |
| Fdamdd | 0.35 |
| Skinsen | 0.047 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.016 |
| Bcf | 2.219 |
| Igc50 | 4.687 |
| Lc50 | 5.773 |
| Lc50dm | 5.55 |
| Nr-ar | 0.327 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.889 |
| Nr-aromatase | 0.903 |
| Nr-er | 0.306 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.231 |
| Sr-are | 0.685 |
| Sr-atad5 | 0.03 |
| Sr-hse | 0.483 |
| Sr-mmp | 0.835 |
| Sr-p53 | 0.945 |
| Vol | 401.283 |
| Dense | 1.089 |
| Flex | 0.333 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.594 |
| Synth | 2.734 |
| Fsp3 | 0.2 |
| Mce-18 | 40 |
| Natural product-likeness | -1.306 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |