| General Information | |
|---|---|
| ZINC ID | ZINC000013474271 |
| Molecular Weight (Da) | 452 |
| SMILES | Cc1c(C(=O)NNCC(C)C)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C21Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.265 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 6.42 |
| Activity (Ki) in nM | 35.4813 |
| Polar Surface Area (PSA) | 58.95 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.912 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.24 |
| Ilogp | 4.61 |
| Xlogp3 | 6.51 |
| Wlogp | 5.7 |
| Mlogp | 4.87 |
| Silicos-it log p | 5.26 |
| Consensus log p | 5.39 |
| Esol log s | -6.71 |
| Esol solubility (mg/ml) | 0.0000873 |
| Esol solubility (mol/l) | 0.00000019 |
| Esol class | Poorly sol |
| Ali log s | -7.54 |
| Ali solubility (mg/ml) | 0.0000129 |
| Ali solubility (mol/l) | 2.85E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.83 |
| Silicos-it solubility (mg/ml) | 0.00000066 |
| Silicos-it solubility (mol/l) | 1.47E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.43 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.211 |
| Logd | 5.247 |
| Logp | 5.697 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 98.18% |
| Vdss | 1.755 |
| Fu | 2.00% |
| Cyp1a2-inh | 0.271 |
| Cyp1a2-sub | 0.617 |
| Cyp2c19-inh | 0.946 |
| Cyp2c19-sub | 0.831 |
| Cl | 6.356 |
| T12 | 0.061 |
| H-ht | 0.949 |
| Dili | 0.982 |
| Roa | 0.386 |
| Fdamdd | 0.537 |
| Skinsen | 0.043 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.17 |
| Bcf | 3.673 |
| Igc50 | 5.156 |
| Lc50 | 6.616 |
| Lc50dm | 6.241 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.984 |
| Nr-aromatase | 0.92 |
| Nr-er | 0.966 |
| Nr-er-lbd | 0.653 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.944 |
| Sr-atad5 | 0.913 |
| Sr-hse | 0.65 |
| Sr-mmp | 0.943 |
| Sr-p53 | 0.927 |
| Vol | 420.785 |
| Dense | 1.07 |
| Flex | 0.389 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.473 |
| Synth | 2.469 |
| Fsp3 | 0.238 |
| Mce-18 | 20 |
| Natural product-likeness | -1.347 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |