| General Information | |
|---|---|
| ZINC ID | ZINC000013475533 |
| Molecular Weight (Da) | 364 |
| SMILES | CCCCC/C=CC/C=CC/C=CC=C[C@@H](O)CCCC(=O)NCCO |
| Molecular Formula | C22N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.48 |
| HBA | 3 |
| HBD | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| LogP | 4.376 |
| Activity (Ki) in nM | 707.946 |
| Polar Surface Area (PSA) | 69.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.91152322 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.59 |
| Ilogp | 5.35 |
| Xlogp3 | 7.19 |
| Wlogp | 4.21 |
| Mlogp | 5.24 |
| Silicos-it log p | 7.3 |
| Consensus log p | 6.41 |
| Esol log s | -7.48 |
| Esol solubility (mg/ml) | 0.0000181 |
| Esol solubility (mol/l) | 3.34E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.25 |
| Ali solubility (mg/ml) | 0.00000305 |
| Ali solubility (mol/l) | 5.62E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -12.04 |
| Silicos-it solubility (mg/ml) | 4.90E-10 |
| Silicos-it solubility (mol/l) | 9.04E-13 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.5 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.7 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.406 |
| Logd | 2.233 |
| Logp | 1.642 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | 8.63E-05 |
| Ppb | 0.9086 |
| Vdss | 0.578 |
| Fu | 0.1015 |
| Cyp1a2-inh | 0.12 |
| Cyp1a2-sub | 0.262 |
| Cyp2c19-inh | 0.227 |
| Cyp2c19-sub | 0.648 |
| Cl | 7.097 |
| T12 | 0.949 |
| H-ht | 0.35 |
| Dili | 0.033 |
| Roa | 0.012 |
| Fdamdd | 0.865 |
| Skinsen | 0.948 |
| Ec | 0.004 |
| Ei | 0.043 |
| Respiratory | 0.949 |
| Bcf | 0.762 |
| Igc50 | 4.141 |
| Lc50 | 3.356 |
| Lc50dm | 3.889 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.001 |
| Nr-ahr | 0.005 |
| Nr-aromatase | 0.005 |
| Nr-er | 0.083 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.02 |
| Sr-are | 0.915 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.063 |
| Sr-mmp | 0.013 |
| Sr-p53 | 0.508 |
| Vol | 413.253 |
| Dense | 0.879 |
| Flex | 3.4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.218 |
| Synth | 3.372 |
| Fsp3 | 0.591 |
| Mce-18 | 2 |
| Natural product-likeness | 1.378 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |