| General Information | |
|---|---|
| ZINC ID | ZINC000013476550 |
| Molecular Weight (Da) | 415 |
| SMILES | COc1ccc(C(=O)c2cn(CCN3CCOCC3)c3ccccc23)c2ccccc12 |
| Molecular Formula | C26N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.505 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| LogP | 4.224 |
| Activity (Ki) in nM | 1.4125 |
| Polar Surface Area (PSA) | 43.7 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.925 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.27 |
| Ilogp | 4 |
| Xlogp3 | 4.16 |
| Wlogp | 3.99 |
| Mlogp | 2.31 |
| Silicos-it log p | 4.66 |
| Consensus log p | 3.82 |
| Esol log s | -5.09 |
| Esol solubility (mg/ml) | 0.00338 |
| Esol solubility (mol/l) | 0.00000816 |
| Esol class | Moderately |
| Ali log s | -4.79 |
| Ali solubility (mg/ml) | 0.00679 |
| Ali solubility (mol/l) | 0.0000164 |
| Ali class | Moderately |
| Silicos-it logsw | -7.63 |
| Silicos-it solubility (mg/ml) | 0.00000969 |
| Silicos-it solubility (mol/l) | 2.34E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.87 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.98 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.238 |
| Logd | 3.786 |
| Logp | 4.492 |
| F (20%) | 0.014 |
| F (30%) | 0.631 |
| Mdck | - |
| Ppb | 97.07% |
| Vdss | 2.16 |
| Fu | 0.82% |
| Cyp1a2-inh | 0.541 |
| Cyp1a2-sub | 0.932 |
| Cyp2c19-inh | 0.798 |
| Cyp2c19-sub | 0.185 |
| Cl | 8.99 |
| T12 | 0.017 |
| H-ht | 0.65 |
| Dili | 0.942 |
| Roa | 0.617 |
| Fdamdd | 0.087 |
| Skinsen | 0.181 |
| Ec | 0.003 |
| Ei | 0.021 |
| Respiratory | 0.566 |
| Bcf | 1.657 |
| Igc50 | 4.529 |
| Lc50 | 5.71 |
| Lc50dm | 6.278 |
| Nr-ar | 0.043 |
| Nr-ar-lbd | 0.042 |
| Nr-ahr | 0.807 |
| Nr-aromatase | 0.704 |
| Nr-er | 0.282 |
| Nr-er-lbd | 0.021 |
| Nr-ppar-gamma | 0.002 |
| Sr-are | 0.832 |
| Sr-atad5 | 0.121 |
| Sr-hse | 0.012 |
| Sr-mmp | 0.34 |
| Sr-p53 | 0.605 |
| Vol | 437.469 |
| Dense | 0.947 |
| Flex | 0.214 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.44 |
| Synth | 2.253 |
| Fsp3 | 0.269 |
| Mce-18 | 56.061 |
| Natural product-likeness | -1.054 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |