| General Information | |
|---|---|
| ZINC ID | ZINC000013493231 |
| Molecular Weight (Da) | 490 |
| SMILES | COc1ccc(-c2c(Br)c(C(=O)NN3CCCCC3)nn2-c2ccccc2Cl)cc1 |
| Molecular Formula | C22Br1Cl1N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.392 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| LogP | 5.598 |
| Activity (Ki) in nM | 6.166 |
| Polar Surface Area (PSA) | 59.39 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.953 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.27 |
| Ilogp | 4.29 |
| Xlogp3 | 5.53 |
| Wlogp | 4.71 |
| Mlogp | 4.17 |
| Silicos-it log p | 4 |
| Consensus log p | 4.54 |
| Esol log s | -6.38 |
| Esol solubility (mg/ml) | 0.000202 |
| Esol solubility (mol/l) | 0.00000041 |
| Esol class | Poorly sol |
| Ali log s | -6.54 |
| Ali solubility (mg/ml) | 0.000142 |
| Ali solubility (mol/l) | 0.00000029 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.6 |
| Silicos-it solubility (mg/ml) | 0.0000124 |
| Silicos-it solubility (mol/l) | 2.52E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.36 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.39 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.9 |
| Logd | 4.209 |
| Logp | 4.424 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 98.44% |
| Vdss | 0.762 |
| Fu | 2.20% |
| Cyp1a2-inh | 0.202 |
| Cyp1a2-sub | 0.829 |
| Cyp2c19-inh | 0.903 |
| Cyp2c19-sub | 0.839 |
| Cl | 6.89 |
| T12 | 0.053 |
| H-ht | 0.729 |
| Dili | 0.963 |
| Roa | 0.651 |
| Fdamdd | 0.269 |
| Skinsen | 0.11 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.841 |
| Bcf | 1.301 |
| Igc50 | 4.746 |
| Lc50 | 6.143 |
| Lc50dm | 5.954 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.063 |
| Nr-ahr | 0.819 |
| Nr-aromatase | 0.913 |
| Nr-er | 0.756 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.919 |
| Sr-are | 0.852 |
| Sr-atad5 | 0.651 |
| Sr-hse | 0.727 |
| Sr-mmp | 0.892 |
| Sr-p53 | 0.918 |
| Vol | 427.176 |
| Dense | 1.143 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.542 |
| Synth | 2.463 |
| Fsp3 | 0.273 |
| Mce-18 | 51.857 |
| Natural product-likeness | -1.266 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |