| General Information | |
|---|---|
| ZINC ID | ZINC000013553596 |
| Molecular Weight (Da) | 363 |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(C(C)(C)c3ccccc3)cc1OC2(C)C |
| Molecular Formula | C25O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.761 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| LogP | 6.206 |
| Activity (Ki) in nM | 0.912 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.023 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.44 |
| Ilogp | 4.01 |
| Xlogp3 | 8.38 |
| Wlogp | 6.33 |
| Mlogp | 5 |
| Silicos-it log p | 5.81 |
| Consensus log p | 5.9 |
| Esol log s | -7.56 |
| Esol solubility (mg/ml) | 0.0000099 |
| Esol solubility (mol/l) | 2.73E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.87 |
| Ali solubility (mg/ml) | 0.00000049 |
| Ali solubility (mol/l) | 1.36E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.23 |
| Silicos-it solubility (mg/ml) | 0.0000212 |
| Silicos-it solubility (mol/l) | 5.83E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.56 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.372 |
| Logd | 5.288 |
| Logp | 7.706 |
| F (20%) | 0.945 |
| F (30%) | 0.979 |
| Mdck | 1.52E-05 |
| Ppb | 1.0059 |
| Vdss | 6.19 |
| Fu | 0.026 |
| Cyp1a2-inh | 0.156 |
| Cyp1a2-sub | 0.5 |
| Cyp2c19-inh | 0.868 |
| Cyp2c19-sub | 0.795 |
| Cl | 3.044 |
| T12 | 0.062 |
| H-ht | 0.901 |
| Dili | 0.047 |
| Roa | 0.099 |
| Fdamdd | 0.941 |
| Skinsen | 0.449 |
| Ec | 0.005 |
| Ei | 0.677 |
| Respiratory | 0.352 |
| Bcf | 3.04 |
| Igc50 | 5.055 |
| Lc50 | 6.147 |
| Lc50dm | 6.233 |
| Nr-ar | 0.062 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.143 |
| Nr-aromatase | 0.827 |
| Nr-er | 0.231 |
| Nr-er-lbd | 0.666 |
| Nr-ppar-gamma | 0.293 |
| Sr-are | 0.737 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.204 |
| Sr-mmp | 0.955 |
| Sr-p53 | 0.603 |
| Vol | 405.855 |
| Dense | 0.892 |
| Flex | 0.091 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.633 |
| Synth | 3.48 |
| Fsp3 | 0.44 |
| Mce-18 | 85.222 |
| Natural product-likeness | 1.463 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |