| General Information | |
|---|---|
| ZINC ID | ZINC000013553599 |
| Molecular Weight (Da) | 348 |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(C(=O)c3ccccc3)cc1OC2(C)C |
| Molecular Formula | C23O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.576 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| LogP | 5.177 |
| Activity (Ki) in nM | 23.442 |
| Polar Surface Area (PSA) | 46.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96374648 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.35 |
| Ilogp | 3.48 |
| Xlogp3 | 5.5 |
| Wlogp | 5.23 |
| Mlogp | 3.62 |
| Silicos-it log p | 4.88 |
| Consensus log p | 4.54 |
| Esol log s | -5.67 |
| Esol solubility (mg/ml) | 0.000737 |
| Esol solubility (mol/l) | 0.00000211 |
| Esol class | Moderately |
| Ali log s | -6.24 |
| Ali solubility (mg/ml) | 0.000203 |
| Ali solubility (mol/l) | 0.00000058 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.37 |
| Silicos-it solubility (mg/ml) | 0.000149 |
| Silicos-it solubility (mol/l) | 0.00000042 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.52 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.13 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.077 |
| Logd | 4.531 |
| Logp | 6.448 |
| F (20%) | 0.07 |
| F (30%) | 0.121 |
| Mdck | 1.62E-05 |
| Ppb | 1.0094 |
| Vdss | 1.185 |
| Fu | 0.0071 |
| Cyp1a2-inh | 0.655 |
| Cyp1a2-sub | 0.597 |
| Cyp2c19-inh | 0.901 |
| Cyp2c19-sub | 0.162 |
| Cl | 1.623 |
| T12 | 0.163 |
| H-ht | 0.803 |
| Dili | 0.794 |
| Roa | 0.286 |
| Fdamdd | 0.817 |
| Skinsen | 0.045 |
| Ec | 0.003 |
| Ei | 0.024 |
| Respiratory | 0.789 |
| Bcf | 1.664 |
| Igc50 | 4.934 |
| Lc50 | 5.775 |
| Lc50dm | 6.207 |
| Nr-ar | 0.02 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.876 |
| Nr-aromatase | 0.869 |
| Nr-er | 0.699 |
| Nr-er-lbd | 0.924 |
| Nr-ppar-gamma | 0.135 |
| Sr-are | 0.592 |
| Sr-atad5 | 0.04 |
| Sr-hse | 0.673 |
| Sr-mmp | 0.962 |
| Sr-p53 | 0.748 |
| Vol | 377.417 |
| Dense | 0.923 |
| Flex | 0.087 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.597 |
| Synth | 3.305 |
| Fsp3 | 0.348 |
| Mce-18 | 79.742 |
| Natural product-likeness | 1.641 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |