| General Information | |
|---|---|
| ZINC ID | ZINC000013606333 |
| Molecular Weight (Da) | 341 |
| SMILES | CCCCCc1cc2c(c3c1CCCO3)[C@@H]1CC=CC[C@H]1C(C)(C)O2 |
| Molecular Formula | C23O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 104.843 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 6.42 |
| Activity (Ki) in nM | 363.078 |
| Polar Surface Area (PSA) | 18.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.65181595 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 4.46 |
| Xlogp3 | 6.53 |
| Wlogp | 5.97 |
| Mlogp | 4.83 |
| Silicos-it log p | 6.17 |
| Consensus log p | 5.59 |
| Esol log s | -5.98 |
| Esol solubility (mg/ml) | 0.000358 |
| Esol solubility (mol/l) | 0.00000105 |
| Esol class | Moderately |
| Ali log s | -6.72 |
| Ali solubility (mg/ml) | 0.0000656 |
| Ali solubility (mol/l) | 0.00000019 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.45 |
| Silicos-it solubility (mg/ml) | 0.00012 |
| Silicos-it solubility (mol/l) | 0.00000035 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.74 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.621 |
| Logd | 5.293 |
| Logp | 8.167 |
| F (20%) | 0.019 |
| F (30%) | 0.932 |
| Mdck | - |
| Ppb | 99.70% |
| Vdss | 4.468 |
| Fu | 2.33% |
| Cyp1a2-inh | 0.289 |
| Cyp1a2-sub | 0.735 |
| Cyp2c19-inh | 0.611 |
| Cyp2c19-sub | 0.375 |
| Cl | 3.806 |
| T12 | 0.048 |
| H-ht | 0.859 |
| Dili | 0.066 |
| Roa | 0.188 |
| Fdamdd | 0.86 |
| Skinsen | 0.456 |
| Ec | 0.003 |
| Ei | 0.021 |
| Respiratory | 0.273 |
| Bcf | 2.875 |
| Igc50 | 5.166 |
| Lc50 | 6.403 |
| Lc50dm | 6.41 |
| Nr-ar | 0.213 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.826 |
| Nr-aromatase | 0.859 |
| Nr-er | 0.192 |
| Nr-er-lbd | 0.061 |
| Nr-ppar-gamma | 0.457 |
| Sr-are | 0.606 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.18 |
| Sr-mmp | 0.781 |
| Sr-p53 | 0.598 |
| Vol | 379.173 |
| Dense | 0.897 |
| Flex | 0.19 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.497 |
| Synth | 3.778 |
| Fsp3 | 0.652 |
| Mce-18 | 75.263 |
| Natural product-likeness | 1.499 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |