| General Information | |
|---|---|
| ZINC ID | ZINC000013611839 |
| Molecular Weight (Da) | 467 |
| SMILES | O=C(NN1CCCCC1)c1nc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)s1 |
| Molecular Formula | C21Cl3N3O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.909 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 6.638 |
| Activity (Ki) in nM | 5888.437 |
| Polar Surface Area (PSA) | 73.47 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.908 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.24 |
| Ilogp | 4.26 |
| Xlogp3 | 6.85 |
| Wlogp | 6.19 |
| Mlogp | 4.62 |
| Silicos-it log p | 6.71 |
| Consensus log p | 5.72 |
| Esol log s | -7.15 |
| Esol solubility (mg/ml) | 0.0000328 |
| Esol solubility (mol/l) | 7.02E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.2 |
| Ali solubility (mg/ml) | 0.00000293 |
| Ali solubility (mol/l) | 6.28E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.76 |
| Silicos-it solubility (mg/ml) | 0.00000081 |
| Silicos-it solubility (mol/l) | 1.74E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.28 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.65 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.283 |
| Logd | 4.901 |
| Logp | 5.93 |
| F (20%) | 0.009 |
| F (30%) | 0.868 |
| Mdck | 4.23E-06 |
| Ppb | 1.0124 |
| Vdss | 1.298 |
| Fu | 0.0093 |
| Cyp1a2-inh | 0.685 |
| Cyp1a2-sub | 0.604 |
| Cyp2c19-inh | 0.887 |
| Cyp2c19-sub | 0.109 |
| Cl | 4.855 |
| T12 | 0.012 |
| H-ht | 0.971 |
| Dili | 0.972 |
| Roa | 0.484 |
| Fdamdd | 0.211 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.215 |
| Bcf | 2.876 |
| Igc50 | 5.006 |
| Lc50 | 6.324 |
| Lc50dm | 5.91 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.924 |
| Nr-ahr | 0.985 |
| Nr-aromatase | 0.955 |
| Nr-er | 0.817 |
| Nr-er-lbd | 0.077 |
| Nr-ppar-gamma | 0.971 |
| Sr-are | 0.973 |
| Sr-atad5 | 0.905 |
| Sr-hse | 0.912 |
| Sr-mmp | 0.986 |
| Sr-p53 | 0.988 |
| Vol | 419.741 |
| Dense | 1.108 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.473 |
| Synth | 2.517 |
| Fsp3 | 0.238 |
| Mce-18 | 52.462 |
| Natural product-likeness | -1.311 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |