| General Information | |
|---|---|
| ZINC ID | ZINC000013611863 |
| Molecular Weight (Da) | 497 |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(C(F)(F)F)cc1 |
| Molecular Formula | C23Cl2F3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.69 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 6.465 |
| Activity (Ki) in nM | 630.957 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.991 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.33 |
| Xlogp3 | 6.56 |
| Wlogp | 7.08 |
| Mlogp | 4.98 |
| Silicos-it log p | 5.5 |
| Consensus log p | 5.69 |
| Esol log s | -7.04 |
| Esol solubility (mg/ml) | 0.0000452 |
| Esol solubility (mol/l) | 9.09E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.41 |
| Ali solubility (mg/ml) | 0.0000193 |
| Ali solubility (mol/l) | 3.87E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.5 |
| Silicos-it solubility (mg/ml) | 0.00000158 |
| Silicos-it solubility (mol/l) | 3.17E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.68 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.51 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.183 |
| Logd | 4.688 |
| Logp | 5.285 |
| F (20%) | 0.003 |
| F (30%) | 0.003 |
| Mdck | 4.19E-06 |
| Ppb | 0.9908 |
| Vdss | 1.607 |
| Fu | 0.0115 |
| Cyp1a2-inh | 0.219 |
| Cyp1a2-sub | 0.876 |
| Cyp2c19-inh | 0.822 |
| Cyp2c19-sub | 0.756 |
| Cl | 3.425 |
| T12 | 0.015 |
| H-ht | 0.846 |
| Dili | 0.85 |
| Roa | 0.782 |
| Fdamdd | 0.945 |
| Skinsen | 0.021 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.723 |
| Bcf | 1.828 |
| Igc50 | 4.835 |
| Lc50 | 6.044 |
| Lc50dm | 6.773 |
| Nr-ar | 0.022 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.749 |
| Nr-aromatase | 0.922 |
| Nr-er | 0.633 |
| Nr-er-lbd | 0.052 |
| Nr-ppar-gamma | 0.294 |
| Sr-are | 0.907 |
| Sr-atad5 | 0.019 |
| Sr-hse | 0.374 |
| Sr-mmp | 0.874 |
| Sr-p53 | 0.897 |
| Vol | 449.812 |
| Dense | 1.103 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 2 |
| Qed | 0.46 |
| Synth | 2.593 |
| Fsp3 | 0.304 |
| Mce-18 | 60.667 |
| Natural product-likeness | -1.496 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Accepted |