| General Information | |
|---|---|
| ZINC ID | ZINC000013676079 |
| Molecular Weight (Da) | 490 |
| SMILES | O=C(NN1CCCCC1)c1nn(-c2ccc(Cl)cc2Cl)c2c1CCCc1ccc(Cl)cc1-2 |
| Molecular Formula | C24Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.797 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| LogP | 7.252 |
| Activity (Ki) in nM | 26.915 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.982 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.67 |
| Xlogp3 | 6.96 |
| Wlogp | 5.74 |
| Mlogp | 5.49 |
| Silicos-it log p | 5.42 |
| Consensus log p | 5.66 |
| Esol log s | -7.39 |
| Esol solubility (mg/ml) | 0.0000199 |
| Esol solubility (mol/l) | 4.07E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.83 |
| Ali solubility (mg/ml) | 0.0000073 |
| Ali solubility (mol/l) | 1.49E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.68 |
| Silicos-it solubility (mg/ml) | 0.00000102 |
| Silicos-it solubility (mol/l) | 2.09E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.35 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.068 |
| Logd | 5.02 |
| Logp | 6.21 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 5.62E-06 |
| Ppb | 0.9943 |
| Vdss | 1.863 |
| Fu | 0.0172 |
| Cyp1a2-inh | 0.196 |
| Cyp1a2-sub | 0.892 |
| Cyp2c19-inh | 0.917 |
| Cyp2c19-sub | 0.652 |
| Cl | 5.366 |
| T12 | 0.016 |
| H-ht | 0.766 |
| Dili | 0.946 |
| Roa | 0.785 |
| Fdamdd | 0.39 |
| Skinsen | 0.055 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.633 |
| Bcf | 2.537 |
| Igc50 | 5.173 |
| Lc50 | 6.449 |
| Lc50dm | 5.881 |
| Nr-ar | 0.024 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.942 |
| Nr-aromatase | 0.931 |
| Nr-er | 0.682 |
| Nr-er-lbd | 0.052 |
| Nr-ppar-gamma | 0.93 |
| Sr-are | 0.935 |
| Sr-atad5 | 0.081 |
| Sr-hse | 0.746 |
| Sr-mmp | 0.961 |
| Sr-p53 | 0.964 |
| Vol | 455.56 |
| Dense | 1.071 |
| Flex | 0.138 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.482 |
| Synth | 2.613 |
| Fsp3 | 0.333 |
| Mce-18 | 67.5 |
| Natural product-likeness | -1.326 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |