| General Information | |
|---|---|
| ZINC ID | ZINC000013678297 |
| Molecular Weight (Da) | 384 |
| SMILES | CCCCCn1cc(C(=O)Nc2cccc3ccccc23)c(=O)c2ccccc21 |
| Molecular Formula | C25N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.484 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 5.595 |
| Activity (Ki) in nM | 4073.8 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08911669 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 20 |
| Fraction csp3 | 0.2 |
| Ilogp | 3.48 |
| Xlogp3 | 5.78 |
| Wlogp | 5.41 |
| Mlogp | 3.5 |
| Silicos-it log p | 5.28 |
| Consensus log p | 4.69 |
| Esol log s | -5.91 |
| Esol solubility (mg/ml) | 0.000469 |
| Esol solubility (mol/l) | 0.00000122 |
| Esol class | Moderately |
| Ali log s | -6.62 |
| Ali solubility (mg/ml) | 0.0000918 |
| Ali solubility (mol/l) | 0.00000023 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.92 |
| Silicos-it solubility (mg/ml) | 0.00000046 |
| Silicos-it solubility (mol/l) | 1.21E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.54 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.63 |
| Logd | 4.035 |
| Logp | 5.415 |
| F (20%) | 0.938 |
| F (30%) | 0.995 |
| Mdck | - |
| Ppb | 97.39% |
| Vdss | 1.263 |
| Fu | 0.83% |
| Cyp1a2-inh | 0.471 |
| Cyp1a2-sub | 0.221 |
| Cyp2c19-inh | 0.805 |
| Cyp2c19-sub | 0.069 |
| Cl | 2.167 |
| T12 | 0.066 |
| H-ht | 0.788 |
| Dili | 0.963 |
| Roa | 0.161 |
| Fdamdd | 0.309 |
| Skinsen | 0.925 |
| Ec | 0.003 |
| Ei | 0.776 |
| Respiratory | 0.522 |
| Bcf | 1.644 |
| Igc50 | 5.081 |
| Lc50 | 5.617 |
| Lc50dm | 5.989 |
| Nr-ar | 0.286 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.904 |
| Nr-aromatase | 0.914 |
| Nr-er | 0.64 |
| Nr-er-lbd | 0.143 |
| Nr-ppar-gamma | 0.709 |
| Sr-are | 0.891 |
| Sr-atad5 | 0.395 |
| Sr-hse | 0.697 |
| Sr-mmp | 0.897 |
| Sr-p53 | 0.831 |
| Vol | 417.303 |
| Dense | 0.921 |
| Flex | 0.292 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 5 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.44 |
| Synth | 1.996 |
| Fsp3 | 0.2 |
| Mce-18 | 21 |
| Natural product-likeness | -1.197 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |