| General Information | |
|---|---|
| ZINC ID | ZINC000013678299 |
| Molecular Weight (Da) | 399 |
| SMILES | CCCCCCn1cc(C(=O)Nc2cccc3ccccc23)c(=O)c2ccccc21 |
| Molecular Formula | C26N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.085 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| LogP | 6.051 |
| Activity (Ki) in nM | 851.138 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.10785985 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 20 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.62 |
| Xlogp3 | 6.33 |
| Wlogp | 5.8 |
| Mlogp | 3.71 |
| Silicos-it log p | 5.68 |
| Consensus log p | 5.03 |
| Esol log s | -6.26 |
| Esol solubility (mg/ml) | 2.17E-04 |
| Esol solubility (mol/l) | 5.45E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.19 |
| Ali solubility (mg/ml) | 2.56E-05 |
| Ali solubility (mol/l) | 6.41E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.31 |
| Silicos-it solubility (mg/ml) | 1.96E-07 |
| Silicos-it solubility (mol/l) | 4.91E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.24 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 2.83 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.631 |
| Logd | 4.213 |
| Logp | 5.827 |
| F (20%) | 0.949 |
| F (30%) | 0.997 |
| Mdck | 1.17E-05 |
| Ppb | 0.9788 |
| Vdss | 1.447 |
| Fu | 0.0075 |
| Cyp1a2-inh | 0.412 |
| Cyp1a2-sub | 0.215 |
| Cyp2c19-inh | 0.796 |
| Cyp2c19-sub | 0.067 |
| Cl | 2.287 |
| T12 | 0.054 |
| H-ht | 0.769 |
| Dili | 0.962 |
| Roa | 0.15 |
| Fdamdd | 0.32 |
| Skinsen | 0.932 |
| Ec | 0.003 |
| Ei | 0.789 |
| Respiratory | 0.534 |
| Bcf | 1.581 |
| Igc50 | 5.204 |
| Lc50 | 5.671 |
| Lc50dm | 6.019 |
| Nr-ar | 0.296 |
| Nr-ar-lbd | 0.013 |
| Nr-ahr | 0.891 |
| Nr-aromatase | 0.916 |
| Nr-er | 0.633 |
| Nr-er-lbd | 0.156 |
| Nr-ppar-gamma | 0.743 |
| Sr-are | 0.892 |
| Sr-atad5 | 0.346 |
| Sr-hse | 0.714 |
| Sr-mmp | 0.906 |
| Sr-p53 | 0.815 |
| Vol | 434.599 |
| Dense | 0.916 |
| Flex | 24 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 5 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.389 |
| Fsp3 | 2.028 |
| Mce-18 | 0.231 |
| Natural product-likeness | 21 |
| Alarm nmr | -1.122 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |