| General Information | |
|---|---|
| ZINC ID | ZINC000013678345 |
| Molecular Weight (Da) | 413 |
| SMILES | CCCCCn1cc(C(=O)N[C@H](C)c2cccc3ccccc23)c(=O)c2ccccc21 |
| Molecular Formula | C27N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.737 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| LogP | 5.979 |
| Activity (Ki) in nM | 125.893 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.10716378 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 20 |
| Fraction csp3 | 0.26 |
| Ilogp | 3.71 |
| Xlogp3 | 6.67 |
| Wlogp | 5.51 |
| Mlogp | 3.64 |
| Silicos-it log p | 5.91 |
| Consensus log p | 5.09 |
| Esol log s | -6.55 |
| Esol solubility (mg/ml) | 1.16E-04 |
| Esol solubility (mol/l) | 2.82E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.55 |
| Ali solubility (mg/ml) | 1.17E-05 |
| Ali solubility (mol/l) | 2.85E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.33 |
| Silicos-it solubility (mg/ml) | 1.94E-07 |
| Silicos-it solubility (mol/l) | 4.70E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.08 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.32 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.325 |
| Logd | 4.252 |
| Logp | 5.629 |
| F (20%) | 0.798 |
| F (30%) | 0.987 |
| Mdck | 1.08E-05 |
| Ppb | 0.9812 |
| Vdss | 1.281 |
| Fu | 0.0085 |
| Cyp1a2-inh | 0.425 |
| Cyp1a2-sub | 0.501 |
| Cyp2c19-inh | 0.785 |
| Cyp2c19-sub | 0.072 |
| Cl | 2.512 |
| T12 | 0.034 |
| H-ht | 0.76 |
| Dili | 0.942 |
| Roa | 0.032 |
| Fdamdd | 0.914 |
| Skinsen | 0.582 |
| Ec | 0.003 |
| Ei | 0.049 |
| Respiratory | 0.325 |
| Bcf | 1.76 |
| Igc50 | 5.102 |
| Lc50 | 5.907 |
| Lc50dm | 5.923 |
| Nr-ar | 0.702 |
| Nr-ar-lbd | 0.02 |
| Nr-ahr | 0.625 |
| Nr-aromatase | 0.883 |
| Nr-er | 0.297 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.419 |
| Sr-are | 0.601 |
| Sr-atad5 | 0.031 |
| Sr-hse | 0.287 |
| Sr-mmp | 0.625 |
| Sr-p53 | 0.635 |
| Vol | 451.895 |
| Dense | 0.912 |
| Flex | 24 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.388 |
| Fsp3 | 2.559 |
| Mce-18 | 0.259 |
| Natural product-likeness | 44 |
| Alarm nmr | -1.107 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |