| General Information | |
|---|---|
| ZINC ID | ZINC000013680121 |
| Molecular Weight (Da) | 328 |
| SMILES | O=C1[C@@H](c2ccccc2)N(c2ccccc2)C(=O)N1c1ccccc1 |
| Molecular Formula | C21N2O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 95.872 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| LogP | 4.744 |
| Activity (Ki) in nM | 6309.57 |
| Polar Surface Area (PSA) | 40.62 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75757825 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.05 |
| Ilogp | 2.99 |
| Xlogp3 | 4.13 |
| Wlogp | 3.32 |
| Mlogp | 3.74 |
| Silicos-it log p | 2.81 |
| Consensus log p | 3.4 |
| Esol log s | -4.81 |
| Esol solubility (mg/ml) | 0.00506 |
| Esol solubility (mol/l) | 0.0000154 |
| Esol class | Moderately |
| Ali log s | -4.69 |
| Ali solubility (mg/ml) | 0.00671 |
| Ali solubility (mol/l) | 0.0000204 |
| Ali class | Moderately |
| Silicos-it logsw | -6.46 |
| Silicos-it solubility (mg/ml) | 0.000115 |
| Silicos-it solubility (mol/l) | 0.00000035 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.37 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.84 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.409 |
| Logd | 3.845 |
| Logp | 3.61 |
| F (20%) | 0.952 |
| F (30%) | 0.008 |
| Mdck | - |
| Ppb | 97.36% |
| Vdss | 0.456 |
| Fu | 1.91% |
| Cyp1a2-inh | 0.32 |
| Cyp1a2-sub | 0.075 |
| Cyp2c19-inh | 0.064 |
| Cyp2c19-sub | 0.145 |
| Cl | 5.025 |
| T12 | 0.779 |
| H-ht | 0.538 |
| Dili | 0.943 |
| Roa | 0.072 |
| Fdamdd | 0.278 |
| Skinsen | 0.327 |
| Ec | 0.003 |
| Ei | 0.14 |
| Respiratory | 0.138 |
| Bcf | 1.379 |
| Igc50 | 4.609 |
| Lc50 | 4.783 |
| Lc50dm | 4.695 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.187 |
| Nr-ahr | 0.642 |
| Nr-aromatase | 0.551 |
| Nr-er | 0.79 |
| Nr-er-lbd | 0.041 |
| Nr-ppar-gamma | 0.076 |
| Sr-are | 0.626 |
| Sr-atad5 | 0.478 |
| Sr-hse | 0.004 |
| Sr-mmp | 0.824 |
| Sr-p53 | 0.366 |
| Vol | 348.119 |
| Dense | 0.943 |
| Flex | 0.125 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.618 |
| Synth | 2.015 |
| Fsp3 | 0 |
| Mce-18 | 20 |
| Natural product-likeness | -0.49 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |