| General Information | |
|---|---|
| ZINC ID | ZINC000013681076 |
| Molecular Weight (Da) | 373 |
| SMILES | CCCCCCC(C)(C)c1cc(O)c([C@@H]2C=C(C)CC[C@H]2C(C)C)c(O)c1 |
| Molecular Formula | C25O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.406 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| LogP | 8.129 |
| Activity (Ki) in nM | 123.027 |
| Polar Surface Area (PSA) | 40.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.05448365 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 4.75 |
| Xlogp3 | 8.55 |
| Wlogp | 7.44 |
| Mlogp | 5.25 |
| Silicos-it log p | 6.71 |
| Consensus log p | 6.54 |
| Esol log s | -7.17 |
| Esol solubility (mg/ml) | 0.000025 |
| Esol solubility (mol/l) | 6.71E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.27 |
| Ali solubility (mg/ml) | 0.00000019 |
| Ali solubility (mol/l) | 5.33E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.59 |
| Silicos-it solubility (mg/ml) | 0.0000951 |
| Silicos-it solubility (mol/l) | 0.00000025 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.5 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.48 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.351 |
| Logd | 5.413 |
| Logp | 8.547 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.16% |
| Vdss | 8.681 |
| Fu | 2.56% |
| Cyp1a2-inh | 0.203 |
| Cyp1a2-sub | 0.836 |
| Cyp2c19-inh | 0.85 |
| Cyp2c19-sub | 0.88 |
| Cl | 4.45 |
| T12 | 0.025 |
| H-ht | 0.196 |
| Dili | 0.209 |
| Roa | 0.383 |
| Fdamdd | 0.914 |
| Skinsen | 0.944 |
| Ec | 0.035 |
| Ei | 0.901 |
| Respiratory | 0.929 |
| Bcf | 1.626 |
| Igc50 | 5.313 |
| Lc50 | 6.286 |
| Lc50dm | 6.622 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.024 |
| Nr-aromatase | 0.463 |
| Nr-er | 0.823 |
| Nr-er-lbd | 0.955 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.757 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.629 |
| Sr-mmp | 0.991 |
| Sr-p53 | 0.186 |
| Vol | 430.878 |
| Dense | 0.864 |
| Flex | 0.667 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.367 |
| Synth | 3.613 |
| Fsp3 | 0.68 |
| Mce-18 | 54.238 |
| Natural product-likeness | 1.513 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |