| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013742549 |
| Molecular Weight (Da) | 377 |
| SMILES | CCc1ccc(C(=O)c2c(C)n(CCN3CCOCC3)c3ccccc23)cc1 |
| Molecular Formula | C24N2O2 |
| Action | Antagonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013742549 |
| Molecular Weight (Da) | 377 |
| SMILES | CCc1ccc(C(=O)c2c(C)n(CCN3CCOCC3)c3ccccc23)cc1 |
| Molecular Formula | C24N2O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013742549 |
| Molar Refractivity | 112.133 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 4.557 |
| Activity (Ki) in nM | 309.03 |
| Polar Surface Area (PSA) | 34.47 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013742549 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | + |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.90449541 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.38 |
| Ilogp | 3.96 |
| Xlogp3 | 4.14 |
| Wlogp | 3.69 |
| Mlogp | 2.64 |
| Silicos-it log p | 5.01 |
| Consensus log p | 3.89 |
| Esol log s | -4.78 |
| Esol solubility (mg/ml) | 0.00621 |
| Esol solubility (mol/l) | 0.0000165 |
| Esol class | Moderately |
| Ali log s | -4.57 |
| Ali solubility (mg/ml) | 0.0101 |
| Ali solubility (mol/l) | 0.0000268 |
| Ali class | Moderately |
| Silicos-it logsw | -7.04 |
| Silicos-it solubility (mg/ml) | 0.0000344 |
| Silicos-it solubility (mol/l) | 9.14E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.04 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -4.718 |
| Logd | 3.943 |
| Logp | 4.413 |
| F (20%) | 0.018 |
| F (30%) | 0.453 |
| Mdck | - |
| Ppb | 95.77% |
| Vdss | 2.758 |
| Fu | 1.89% |
| Cyp1a2-inh | 0.583 |
| Cyp1a2-sub | 0.874 |
| Cyp2c19-inh | 0.748 |
| Cyp2c19-sub | 0.222 |
| Cl | 8.84 |
| T12 | 0.018 |
| H-ht | 0.519 |
| Dili | 0.761 |
| Roa | 0.585 |
| Fdamdd | 0.072 |
| Skinsen | 0.136 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.368 |
| Bcf | 1.829 |
| Igc50 | 4.384 |
| Lc50 | 5.77 |
| Lc50dm | 5.916 |
| Nr-ar | 0.04 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.514 |
| Nr-aromatase | 0.2 |
| Nr-er | 0.26 |
| Nr-er-lbd | 0.052 |
| Nr-ppar-gamma | 0.004 |
| Sr-are | 0.491 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.006 |
| Sr-mmp | 0.108 |
| Sr-p53 | 0.094 |
| Vol | 407.917 |
| Dense | 0.922 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.608 |
| Synth | 2.154 |
| Fsp3 | 0.375 |
| Mce-18 | 47.091 |
| Natural product-likeness | -1.166 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |