| General Information | |
|---|---|
| ZINC ID | ZINC000013760067 |
| Molecular Weight (Da) | 363 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCC/C(S)=N/CCO |
| Molecular Formula | C22N1O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.614 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| LogP | 6.762 |
| Activity (Ki) in nM | 1380.38 |
| Polar Surface Area (PSA) | 71.39 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.90876883 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.59 |
| Ilogp | 4.3 |
| Xlogp3 | 5.11 |
| Wlogp | 6.45 |
| Mlogp | 3.63 |
| Silicos-it log p | 5.34 |
| Consensus log p | 4.74 |
| Esol log s | -5.23 |
| Esol solubility (mg/ml) | 0.0024 |
| Esol solubility (mol/l) | 0.00000589 |
| Esol class | Moderately |
| Ali log s | -5.85 |
| Ali solubility (mg/ml) | 0.000578 |
| Ali solubility (mol/l) | 0.00000142 |
| Ali class | Moderately |
| Silicos-it logsw | -7.93 |
| Silicos-it solubility (mg/ml) | 0.00000483 |
| Silicos-it solubility (mol/l) | 1.19E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.16 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.1 |
| Logd | 3.014 |
| Logp | 1.906 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.54% |
| Vdss | 2.022 |
| Fu | 1.44% |
| Cyp1a2-inh | 0.384 |
| Cyp1a2-sub | 0.887 |
| Cyp2c19-inh | 0.607 |
| Cyp2c19-sub | 0.097 |
| Cl | 4.203 |
| T12 | 0.958 |
| H-ht | 0.261 |
| Dili | 0.024 |
| Roa | 0.004 |
| Fdamdd | 0.267 |
| Skinsen | 0.962 |
| Ec | 0.004 |
| Ei | 0.18 |
| Respiratory | 0.893 |
| Bcf | 1.204 |
| Igc50 | 5.229 |
| Lc50 | 3.172 |
| Lc50dm | 4.01 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.004 |
| Nr-aromatase | 0.687 |
| Nr-er | 0.094 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.895 |
| Sr-are | 0.843 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.974 |
| Sr-mmp | 0.378 |
| Sr-p53 | 0.787 |
| Vol | 414.182 |
| Dense | 0.877 |
| Flex | 3.4 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.199 |
| Synth | 3.119 |
| Fsp3 | 0.591 |
| Mce-18 | 0 |
| Natural product-likeness | 0.67 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |