| General Information | |
|---|---|
| ZINC ID | ZINC000013760072 |
| Molecular Weight (Da) | 392 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)N(CCO)CCO |
| Molecular Formula | C24N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.154 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| LogP | 5.145 |
| Activity (Ki) in nM | 173.78 |
| Polar Surface Area (PSA) | 60.77 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.48475986 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.68 |
| Xlogp3 | 5.28 |
| Wlogp | 4.95 |
| Mlogp | 4.13 |
| Silicos-it log p | 4.95 |
| Consensus log p | 4.61 |
| Esol log s | -6.2 |
| Esol solubility (mg/ml) | 0.000291 |
| Esol solubility (mol/l) | 0.00000062 |
| Esol class | Poorly sol |
| Ali log s | -6.26 |
| Ali solubility (mg/ml) | 0.000258 |
| Ali solubility (mol/l) | 0.00000055 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.41 |
| Silicos-it solubility (mg/ml) | 0.0000182 |
| Silicos-it solubility (mol/l) | 3.92E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.39 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.114 |
| Logd | 2.067 |
| Logp | 1.228 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 95.60% |
| Vdss | 0.914 |
| Fu | 3.24% |
| Cyp1a2-inh | 0.045 |
| Cyp1a2-sub | 0.752 |
| Cyp2c19-inh | 0.19 |
| Cyp2c19-sub | 0.253 |
| Cl | 3.749 |
| T12 | 0.964 |
| H-ht | 0.386 |
| Dili | 0.008 |
| Roa | 0.001 |
| Fdamdd | 0.022 |
| Skinsen | 0.971 |
| Ec | 0.004 |
| Ei | 0.056 |
| Respiratory | 0.793 |
| Bcf | 1.099 |
| Igc50 | 4.586 |
| Lc50 | 2.582 |
| Lc50dm | 3.469 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.005 |
| Nr-aromatase | 0.599 |
| Nr-er | 0.091 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.834 |
| Sr-are | 0.769 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.93 |
| Sr-mmp | 0.183 |
| Sr-p53 | 0.345 |
| Vol | 447.845 |
| Dense | 0.874 |
| Flex | 3.8 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.257 |
| Synth | 2.974 |
| Fsp3 | 0.625 |
| Mce-18 | 0 |
| Natural product-likeness | 0.296 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |