| General Information | |
|---|---|
| ZINC ID | ZINC000013761098 |
| Molecular Weight (Da) | 346 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)NC(C)C |
| Molecular Formula | C23N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.839 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| LogP | 6.744 |
| Activity (Ki) in nM | 13.4896 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.352 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.61 |
| Ilogp | 3.78 |
| Xlogp3 | 6.55 |
| Wlogp | 6.66 |
| Mlogp | 4.77 |
| Silicos-it log p | 5.69 |
| Consensus log p | 5.38 |
| Esol log s | -6.45 |
| Esol solubility (mg/ml) | 0.000145 |
| Esol solubility (mol/l) | 0.00000035 |
| Esol class | Poorly sol |
| Ali log s | -7.33 |
| Ali solubility (mg/ml) | 0.0000193 |
| Ali solubility (mol/l) | 4.73E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.91 |
| Silicos-it solubility (mg/ml) | 0.000506 |
| Silicos-it solubility (mol/l) | 0.00000124 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.14 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 6.12 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.913 |
| Logd | 3.506 |
| Logp | 2.85 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.62% |
| Vdss | 2.718 |
| Fu | 1.11% |
| Cyp1a2-inh | 0.249 |
| Cyp1a2-sub | 0.899 |
| Cyp2c19-inh | 0.511 |
| Cyp2c19-sub | 0.808 |
| Cl | 3.861 |
| T12 | 0.934 |
| H-ht | 0.228 |
| Dili | 0.009 |
| Roa | 0.002 |
| Fdamdd | 0.109 |
| Skinsen | 0.958 |
| Ec | 0.003 |
| Ei | 0.042 |
| Respiratory | 0.91 |
| Bcf | 1.693 |
| Igc50 | 4.958 |
| Lc50 | 2.931 |
| Lc50dm | 4.425 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.003 |
| Nr-aromatase | 0.011 |
| Nr-er | 0.067 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.455 |
| Sr-are | 0.611 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.935 |
| Sr-mmp | 0.306 |
| Sr-p53 | 0.007 |
| Vol | 412.969 |
| Dense | 0.836 |
| Flex | 3.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.261 |
| Synth | 2.784 |
| Fsp3 | 0.609 |
| Mce-18 | 0 |
| Natural product-likeness | 0.418 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |