| General Information | |
|---|---|
| ZINC ID | ZINC000013761105 |
| Molecular Weight (Da) | 428 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)NCCOP(=O)(O)O |
| Molecular Formula | C22N1O5P1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.265 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| LogP | 5.542 |
| Activity (Ki) in nM | 190.546 |
| Polar Surface Area (PSA) | 105.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.49713227 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.59 |
| Ilogp | 4.96 |
| Xlogp3 | 8.75 |
| Wlogp | 5.36 |
| Mlogp | 5.16 |
| Silicos-it log p | 6.84 |
| Consensus log p | 6.44 |
| Esol log s | -7.46 |
| Esol solubility (mg/ml) | 0.0000127 |
| Esol solubility (mol/l) | 3.47E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.02 |
| Ali solubility (mg/ml) | 0.00000035 |
| Ali solubility (mol/l) | 9.58E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.09 |
| Silicos-it solubility (mg/ml) | 0.00003 |
| Silicos-it solubility (mol/l) | 8.18E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.32 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.929 |
| Logd | -0.014 |
| Logp | 0.056 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.15% |
| Vdss | 0.651 |
| Fu | 1.32% |
| Cyp1a2-inh | 0.026 |
| Cyp1a2-sub | 0.417 |
| Cyp2c19-inh | 0.165 |
| Cyp2c19-sub | 0.063 |
| Cl | 2.421 |
| T12 | 0.945 |
| H-ht | 0.116 |
| Dili | 0.002 |
| Roa | 0.002 |
| Fdamdd | 0.621 |
| Skinsen | 0.96 |
| Ec | 0.004 |
| Ei | 0.038 |
| Respiratory | 0.873 |
| Bcf | 0.812 |
| Igc50 | 4.787 |
| Lc50 | 2.88 |
| Lc50dm | 4.255 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.005 |
| Nr-er | 0.082 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.519 |
| Sr-are | 0.45 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.39 |
| Sr-mmp | 0.036 |
| Sr-p53 | 0.008 |
| Vol | 450.661 |
| Dense | 0.948 |
| Flex | 2.714 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.17 |
| Synth | 3.629 |
| Fsp3 | 0.591 |
| Mce-18 | 0 |
| Natural product-likeness | 0.359 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |