| General Information | |
|---|---|
| ZINC ID | ZINC000013761113 |
| Molecular Weight (Da) | 360 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCC[C@@H](C)C(=O)NCCC |
| Molecular Formula | C24N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.52 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| LogP | 7.353 |
| Activity (Ki) in nM | 7.4131 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.018 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 5.12 |
| Xlogp3 | 7.96 |
| Wlogp | 6.9 |
| Mlogp | 4.43 |
| Silicos-it log p | 7.5 |
| Consensus log p | 6.34 |
| Esol log s | -6.4 |
| Esol solubility (mg/ml) | 0.000165 |
| Esol solubility (mol/l) | 0.00000039 |
| Esol class | Poorly sol |
| Ali log s | -9.04 |
| Ali solubility (mg/ml) | 0.00000038 |
| Ali solubility (mol/l) | 9.10E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.39 |
| Silicos-it solubility (mg/ml) | 0.00000171 |
| Silicos-it solubility (mol/l) | 4.09E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.2 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.52 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.794 |
| Logd | 3.921 |
| Logp | 3.392 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.64% |
| Vdss | 2.734 |
| Fu | 1.46% |
| Cyp1a2-inh | 0.239 |
| Cyp1a2-sub | 0.927 |
| Cyp2c19-inh | 0.457 |
| Cyp2c19-sub | 0.463 |
| Cl | 3.894 |
| T12 | 0.93 |
| H-ht | 0.138 |
| Dili | 0.015 |
| Roa | 0.004 |
| Fdamdd | 0.136 |
| Skinsen | 0.957 |
| Ec | 0.003 |
| Ei | 0.044 |
| Respiratory | 0.846 |
| Bcf | 1.376 |
| Igc50 | 5.17 |
| Lc50 | 2.828 |
| Lc50dm | 4.416 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.001 |
| Nr-aromatase | 0.03 |
| Nr-er | 0.098 |
| Nr-er-lbd | 0.038 |
| Nr-ppar-gamma | 0.574 |
| Sr-are | 0.75 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.951 |
| Sr-mmp | 0.359 |
| Sr-p53 | 0.078 |
| Vol | 430.265 |
| Dense | 0.835 |
| Flex | 3.4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.235 |
| Synth | 3.327 |
| Fsp3 | 0.625 |
| Mce-18 | 2 |
| Natural product-likeness | 0.636 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |