| General Information | |
|---|---|
| ZINC ID | ZINC000013761115 |
| Molecular Weight (Da) | 360 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCC[C@@H](C)C(=O)NC(C)C |
| Molecular Formula | C24N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.414 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| LogP | 7.207 |
| Activity (Ki) in nM | 8.3176 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.241 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.9 |
| Xlogp3 | 4.92 |
| Wlogp | 6.9 |
| Mlogp | 3.22 |
| Silicos-it log p | 5.46 |
| Consensus log p | 4.45 |
| Esol log s | -5.93 |
| Esol solubility (mg/ml) | 0.000579 |
| Esol solubility (mol/l) | 0.00000116 |
| Esol class | Moderately |
| Ali log s | -7.12 |
| Ali solubility (mg/ml) | 0.0000381 |
| Ali solubility (mol/l) | 7.64E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.38 |
| Silicos-it solubility (mg/ml) | 0.00000209 |
| Silicos-it solubility (mol/l) | 4.19E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.84 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.74 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.932 |
| Logd | 3.859 |
| Logp | 3.28 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 100.13% |
| Vdss | 3.171 |
| Fu | 1.48% |
| Cyp1a2-inh | 0.246 |
| Cyp1a2-sub | 0.91 |
| Cyp2c19-inh | 0.486 |
| Cyp2c19-sub | 0.859 |
| Cl | 3.78 |
| T12 | 0.924 |
| H-ht | 0.279 |
| Dili | 0.008 |
| Roa | 0.002 |
| Fdamdd | 0.085 |
| Skinsen | 0.954 |
| Ec | 0.003 |
| Ei | 0.032 |
| Respiratory | 0.897 |
| Bcf | 1.79 |
| Igc50 | 5.088 |
| Lc50 | 3.014 |
| Lc50dm | 4.604 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.001 |
| Nr-aromatase | 0.014 |
| Nr-er | 0.057 |
| Nr-er-lbd | 0.082 |
| Nr-ppar-gamma | 0.254 |
| Sr-are | 0.681 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.95 |
| Sr-mmp | 0.329 |
| Sr-p53 | 0.005 |
| Vol | 430.265 |
| Dense | 0.835 |
| Flex | 3.2 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.25 |
| Synth | 3.364 |
| Fsp3 | 0.625 |
| Mce-18 | 3 |
| Natural product-likeness | 0.713 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |