| General Information | |
|---|---|
| ZINC ID | ZINC000013761123 |
| Molecular Weight (Da) | 360 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)N[C@@H](C)CC |
| Molecular Formula | C24N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.363 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| LogP | 7.268 |
| Activity (Ki) in nM | 2187.762 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.035 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.95 |
| Xlogp3 | 5.34 |
| Wlogp | 7.05 |
| Mlogp | 4.23 |
| Silicos-it log p | 3.88 |
| Consensus log p | 4.71 |
| Esol log s | -5.67 |
| Esol solubility (mg/ml) | 0.000876 |
| Esol solubility (mol/l) | 0.00000215 |
| Esol class | Moderately |
| Ali log s | -6.12 |
| Ali solubility (mg/ml) | 0.000309 |
| Ali solubility (mol/l) | 0.00000075 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.32 |
| Silicos-it solubility (mg/ml) | 0.00000196 |
| Silicos-it solubility (mol/l) | 4.80E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.19 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.847 |
| Logd | 3.914 |
| Logp | 3.343 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | 0.00013645 |
| Ppb | 0.9911 |
| Vdss | 2.338 |
| Fu | 0.0107 |
| Cyp1a2-inh | 0.257 |
| Cyp1a2-sub | 0.911 |
| Cyp2c19-inh | 0.569 |
| Cyp2c19-sub | 0.279 |
| Cl | 3.965 |
| T12 | 0.919 |
| H-ht | 0.42 |
| Dili | 0.026 |
| Roa | 0.003 |
| Fdamdd | 0.334 |
| Skinsen | 0.96 |
| Ec | 0.005 |
| Ei | 0.045 |
| Respiratory | 0.902 |
| Bcf | 1.467 |
| Igc50 | 5.036 |
| Lc50 | 2.787 |
| Lc50dm | 4.188 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.001 |
| Nr-aromatase | 0.012 |
| Nr-er | 0.089 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.852 |
| Sr-are | 0.601 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.93 |
| Sr-mmp | 0.463 |
| Sr-p53 | 0.035 |
| Vol | 430.265 |
| Dense | 0.835 |
| Flex | 3.4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.232 |
| Synth | 3.22 |
| Fsp3 | 0.625 |
| Mce-18 | 2 |
| Natural product-likeness | 0.301 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |