| General Information | |
|---|---|
| ZINC ID | ZINC000013779271 |
| Molecular Weight (Da) | 359 |
| SMILES | CCCCCC[C@H](O)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C)C[C@@H]21 |
| Molecular Formula | C23O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.162 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 5.895 |
| Activity (Ki) in nM | 66.069 |
| Polar Surface Area (PSA) | 49.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.81 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 4.1 |
| Xlogp3 | 7.01 |
| Wlogp | 5.68 |
| Mlogp | 3.95 |
| Silicos-it log p | 5.43 |
| Consensus log p | 5.23 |
| Esol log s | -6.25 |
| Esol solubility (mg/ml) | 0.0002 |
| Esol solubility (mol/l) | 0.00000055 |
| Esol class | Poorly sol |
| Ali log s | -7.87 |
| Ali solubility (mg/ml) | 0.00000485 |
| Ali solubility (mol/l) | 1.35E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.78 |
| Silicos-it solubility (mg/ml) | 0.000594 |
| Silicos-it solubility (mol/l) | 0.00000166 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.51 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.71 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.544 |
| Logd | 4.961 |
| Logp | 7.321 |
| F (20%) | 1 |
| F (30%) | 0.991 |
| Mdck | 1.75E-05 |
| Ppb | 0.9972 |
| Vdss | 4.325 |
| Fu | 0.0309 |
| Cyp1a2-inh | 0.275 |
| Cyp1a2-sub | 0.852 |
| Cyp2c19-inh | 0.676 |
| Cyp2c19-sub | 0.779 |
| Cl | 6.738 |
| T12 | 0.11 |
| H-ht | 0.879 |
| Dili | 0.038 |
| Roa | 0.215 |
| Fdamdd | 0.971 |
| Skinsen | 0.331 |
| Ec | 0.004 |
| Ei | 0.149 |
| Respiratory | 0.737 |
| Bcf | 2.346 |
| Igc50 | 5.092 |
| Lc50 | 6.364 |
| Lc50dm | 6.193 |
| Nr-ar | 0.575 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.351 |
| Nr-aromatase | 0.8 |
| Nr-er | 0.243 |
| Nr-er-lbd | 0.279 |
| Nr-ppar-gamma | 0.859 |
| Sr-are | 0.555 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.365 |
| Sr-mmp | 0.954 |
| Sr-p53 | 0.586 |
| Vol | 396.52 |
| Dense | 0.903 |
| Flex | 0.375 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.484 |
| Synth | 3.738 |
| Fsp3 | 0.652 |
| Mce-18 | 65.263 |
| Natural product-likeness | 2.171 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |