| General Information | |
|---|---|
| ZINC ID | ZINC000013782513 |
| Molecular Weight (Da) | 390 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCCNC(=O)COC(C)=O |
| Molecular Formula | C24N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.172 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| LogP | 5.93 |
| Activity (Ki) in nM | 416.869 |
| Polar Surface Area (PSA) | 55.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.57596945 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.58 |
| Ilogp | 3.79 |
| Xlogp3 | 4.08 |
| Wlogp | 5.81 |
| Mlogp | 1.93 |
| Silicos-it log p | 4.5 |
| Consensus log p | 3.64 |
| Esol log s | -4.95 |
| Esol solubility (mg/ml) | 0.00438 |
| Esol solubility (mol/l) | 0.0000113 |
| Esol class | Moderately |
| Ali log s | -4.78 |
| Ali solubility (mg/ml) | 0.00638 |
| Ali solubility (mol/l) | 0.0000164 |
| Ali class | Moderately |
| Silicos-it logsw | -7.13 |
| Silicos-it solubility (mg/ml) | 0.000029 |
| Silicos-it solubility (mol/l) | 7.46E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.77 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.3 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.807 |
| Logd | 2.676 |
| Logp | 2.168 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.18% |
| Vdss | 0.916 |
| Fu | 2.21% |
| Cyp1a2-inh | 0.277 |
| Cyp1a2-sub | 0.557 |
| Cyp2c19-inh | 0.663 |
| Cyp2c19-sub | 0.245 |
| Cl | 3.633 |
| T12 | 0.957 |
| H-ht | 0.07 |
| Dili | 0.044 |
| Roa | 0.002 |
| Fdamdd | 0.132 |
| Skinsen | 0.95 |
| Ec | 0.004 |
| Ei | 0.055 |
| Respiratory | 0.865 |
| Bcf | 1.131 |
| Igc50 | 5.002 |
| Lc50 | 2.99 |
| Lc50dm | 4.072 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.006 |
| Nr-aromatase | 0.019 |
| Nr-er | 0.134 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.67 |
| Sr-are | 0.754 |
| Sr-atad5 | 0.025 |
| Sr-hse | 0.926 |
| Sr-mmp | 0.128 |
| Sr-p53 | 0.465 |
| Vol | 445.209 |
| Dense | 0.874 |
| Flex | 3.167 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.194 |
| Synth | 2.796 |
| Fsp3 | 0.583 |
| Mce-18 | 0 |
| Natural product-likeness | 0.37 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |