| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013817277 |
| Molecular Weight (Da) | 436 |
| SMILES | COc1cccc2c(C(=O)N[C@H](C)Cc3ccccc3)c(C)n(CCN3CCOCC3)c12 |
| Molecular Formula | C26N3O3 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013817277 |
| Molecular Weight (Da) | 436 |
| SMILES | COc1cccc2c(C(=O)N[C@H](C)Cc3ccccc3)c(C)n(CCN3CCOCC3)c12 |
| Molecular Formula | C26N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013817277 |
| Molar Refractivity | 125.641 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| LogP | 3.685 |
| Activity (Ki) in nM | 263.027 |
| Polar Surface Area (PSA) | 55.73 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000013817277 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.97648948 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.1 |
| Xlogp3 | 3.64 |
| Wlogp | 3.27 |
| Mlogp | 2.35 |
| Silicos-it log p | 4.4 |
| Consensus log p | 3.55 |
| Esol log s | -4.59 |
| Esol solubility (mg/ml) | 1.13E-02 |
| Esol solubility (mol/l) | 2.59E-05 |
| Esol class | Moderately |
| Ali log s | -4.5 |
| Ali solubility (mg/ml) | 1.38E-02 |
| Ali solubility (mol/l) | 3.17E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -7.22 |
| Silicos-it solubility (mg/ml) | 2.65E-05 |
| Silicos-it solubility (mol/l) | 6.08E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.37 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.88 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -3.862 |
| Logd | 3.561 |
| Logp | 3.707 |
| F (20%) | 0.016 |
| F (30%) | 0.068 |
| Mdck | 3.17E-05 |
| Ppb | 0.9045 |
| Vdss | 1.786 |
| Fu | 0.0398 |
| Cyp1a2-inh | 0.3 |
| Cyp1a2-sub | 0.297 |
| Cyp2c19-inh | 0.841 |
| Cyp2c19-sub | 0.875 |
| Cl | 6.888 |
| T12 | 0.049 |
| H-ht | 0.924 |
| Dili | 0.749 |
| Roa | 0.526 |
| Fdamdd | 0.081 |
| Skinsen | 0.051 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.739 |
| Bcf | 1.306 |
| Igc50 | 3.195 |
| Lc50 | 4.927 |
| Lc50dm | 4.437 |
| Nr-ar | 0.826 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.457 |
| Nr-aromatase | 0.039 |
| Nr-er | 0.308 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.049 |
| Sr-are | 0.296 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.022 |
| Sr-mmp | 0.102 |
| Sr-p53 | 0.04 |
| Vol | 462.296 |
| Dense | 0.941 |
| Flex | 23 |
| Nstereo | 0.391 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.587 |
| Fsp3 | 2.795 |
| Mce-18 | 0.423 |
| Natural product-likeness | 70.757 |
| Alarm nmr | -1.042 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |