| General Information | |
|---|---|
| ZINC ID | ZINC000013817289 |
| Molecular Weight (Da) | 478 |
| SMILES | CCC(=O)[C@H](Cc1ccccc1)NC(=O)c1c(C)n(CCN2CCOCC2)c2c(OC)cccc12 |
| Molecular Formula | C28N3O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 135.231 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| LogP | 3.552 |
| Activity (Ki) in nM | 23.988 |
| Polar Surface Area (PSA) | 72.8 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9697265 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.43 |
| Ilogp | 3.71 |
| Xlogp3 | 3.46 |
| Wlogp | 3.23 |
| Mlogp | 1.88 |
| Silicos-it log p | 4.76 |
| Consensus log p | 3.41 |
| Esol log s | -4.57 |
| Esol solubility (mg/ml) | 1.28E-02 |
| Esol solubility (mol/l) | 2.68E-05 |
| Esol class | Moderately |
| Ali log s | -4.67 |
| Ali solubility (mg/ml) | 1.02E-02 |
| Ali solubility (mol/l) | 2.14E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -7.53 |
| Silicos-it solubility (mg/ml) | 1.42E-05 |
| Silicos-it solubility (mol/l) | 2.98E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.76 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.1 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.756 |
| Logd | 3.081 |
| Logp | 2.947 |
| F (20%) | 0.061 |
| F (30%) | 0.534 |
| Mdck | 3.04E-05 |
| Ppb | 0.9026 |
| Vdss | 2.037 |
| Fu | 0.0428 |
| Cyp1a2-inh | 0.091 |
| Cyp1a2-sub | 0.119 |
| Cyp2c19-inh | 0.687 |
| Cyp2c19-sub | 0.901 |
| Cl | 6.998 |
| T12 | 0.242 |
| H-ht | 0.798 |
| Dili | 0.477 |
| Roa | 0.796 |
| Fdamdd | 0.121 |
| Skinsen | 0.04 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.42 |
| Bcf | 1.021 |
| Igc50 | 2.864 |
| Lc50 | 4.132 |
| Lc50dm | 4.574 |
| Nr-ar | 0.536 |
| Nr-ar-lbd | 0.018 |
| Nr-ahr | 0.73 |
| Nr-aromatase | 0.046 |
| Nr-er | 0.248 |
| Nr-er-lbd | 0.177 |
| Nr-ppar-gamma | 0.518 |
| Sr-are | 0.393 |
| Sr-atad5 | 0.048 |
| Sr-hse | 0.023 |
| Sr-mmp | 0.074 |
| Sr-p53 | 0.058 |
| Vol | 503.041 |
| Dense | 0.949 |
| Flex | 24 |
| Nstereo | 0.458 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.483 |
| Fsp3 | 2.963 |
| Mce-18 | 0.429 |
| Natural product-likeness | 73.6 |
| Alarm nmr | -0.711 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Accepted |
| Goldentriangle | Rejected |