| General Information | |
|---|---|
| ZINC ID | ZINC000013817303 |
| Molecular Weight (Da) | 454 |
| SMILES | COc1cccc2c(C(=O)N[C@H]3C(C)(C)[C@@H]4CC[C@@]3(C)C4)c(C)n(CCN3CCOCC3)c12 |
| Molecular Formula | C27N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.755 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| LogP | 3.871 |
| Activity (Ki) in nM | 28.84 |
| Polar Surface Area (PSA) | 55.73 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.813 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.67 |
| Ilogp | 4.55 |
| Xlogp3 | 4.22 |
| Wlogp | 3.85 |
| Mlogp | 2.78 |
| Silicos-it log p | 4.44 |
| Consensus log p | 3.97 |
| Esol log s | -5.05 |
| Esol solubility (mg/ml) | 0.00404 |
| Esol solubility (mol/l) | 0.0000089 |
| Esol class | Moderately |
| Ali log s | -5.1 |
| Ali solubility (mg/ml) | 0.0036 |
| Ali solubility (mol/l) | 0.00000793 |
| Ali class | Moderately |
| Silicos-it logsw | -6.46 |
| Silicos-it solubility (mg/ml) | 0.000158 |
| Silicos-it solubility (mol/l) | 0.00000034 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.07 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.36 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.468 |
| Logd | 4.039 |
| Logp | 4.505 |
| F (20%) | 0.652 |
| F (30%) | 0.948 |
| Mdck | 1.19E-05 |
| Ppb | 0.8516 |
| Vdss | 1.516 |
| Fu | 0.0887 |
| Cyp1a2-inh | 0.075 |
| Cyp1a2-sub | 0.572 |
| Cyp2c19-inh | 0.823 |
| Cyp2c19-sub | 0.925 |
| Cl | 5.657 |
| T12 | 0.041 |
| H-ht | 0.611 |
| Dili | 0.332 |
| Roa | 0.513 |
| Fdamdd | 0.683 |
| Skinsen | 0.074 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.843 |
| Bcf | 1.275 |
| Igc50 | 3.965 |
| Lc50 | 5.432 |
| Lc50dm | 6.44 |
| Nr-ar | 0.488 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.142 |
| Nr-aromatase | 0.072 |
| Nr-er | 0.135 |
| Nr-er-lbd | 0.076 |
| Nr-ppar-gamma | 0.091 |
| Sr-are | 0.228 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.07 |
| Sr-mmp | 0.244 |
| Sr-p53 | 0.303 |
| Vol | 478.944 |
| Dense | 0.946 |
| Flex | 0.28 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.711 |
| Synth | 4.416 |
| Fsp3 | 0.667 |
| Mce-18 | 108.156 |
| Natural product-likeness | -0.116 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |