| General Information | |
|---|---|
| ZINC ID | ZINC000013817365 |
| Molecular Weight (Da) | 440 |
| SMILES | COc1cccc2c(C(=O)N[C@H]3C(C)(C)[C@@H]4CC[C@@]3(C)C4)cn(CCN3CCOCC3)c12 |
| Molecular Formula | C26N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.855 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| LogP | 3.588 |
| Activity (Ki) in nM | 245.471 |
| Polar Surface Area (PSA) | 55.73 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.77650404 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.65 |
| Ilogp | 4.55 |
| Xlogp3 | 3.81 |
| Wlogp | 3.55 |
| Mlogp | 2.58 |
| Silicos-it log p | 3.91 |
| Consensus log p | 3.68 |
| Esol log s | -4.71 |
| Esol solubility (mg/ml) | 0.00853 |
| Esol solubility (mol/l) | 0.0000194 |
| Esol class | Moderately |
| Ali log s | -4.68 |
| Ali solubility (mg/ml) | 0.00929 |
| Ali solubility (mol/l) | 0.0000211 |
| Ali class | Moderately |
| Silicos-it logsw | -6.08 |
| Silicos-it solubility (mg/ml) | 0.000362 |
| Silicos-it solubility (mol/l) | 0.00000082 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.28 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.633 |
| Logd | 4.028 |
| Logp | 4.494 |
| F (20%) | 0.606 |
| F (30%) | 0.842 |
| Mdck | - |
| Ppb | 76.51% |
| Vdss | 1.473 |
| Fu | 16.80% |
| Cyp1a2-inh | 0.07 |
| Cyp1a2-sub | 0.56 |
| Cyp2c19-inh | 0.768 |
| Cyp2c19-sub | 0.911 |
| Cl | 5.833 |
| T12 | 0.053 |
| H-ht | 0.408 |
| Dili | 0.3 |
| Roa | 0.308 |
| Fdamdd | 0.809 |
| Skinsen | 0.12 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.832 |
| Bcf | 1.081 |
| Igc50 | 3.659 |
| Lc50 | 4.642 |
| Lc50dm | 5.956 |
| Nr-ar | 0.36 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.076 |
| Nr-aromatase | 0.06 |
| Nr-er | 0.136 |
| Nr-er-lbd | 0.02 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.276 |
| Sr-atad5 | 0.015 |
| Sr-hse | 0.044 |
| Sr-mmp | 0.209 |
| Sr-p53 | 0.054 |
| Vol | 461.648 |
| Dense | 0.952 |
| Flex | 0.28 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.741 |
| Synth | 4.361 |
| Fsp3 | 0.654 |
| Mce-18 | 105.349 |
| Natural product-likeness | -0.233 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |