| General Information | |
|---|---|
| ZINC ID | ZINC000014975648 |
| Molecular Weight (Da) | 436 |
| SMILES | N#Cc1c(C(=O)NCc2ccc(Cl)c(Cl)c2)nn(-c2ccccc2)c1-n1cccc1 |
| Molecular Formula | C22Cl2N5O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.402 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| LogP | 4.712 |
| Activity (Ki) in nM | 3981.072 |
| Polar Surface Area (PSA) | 75.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08183062 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.05 |
| Ilogp | 3.9 |
| Xlogp3 | 4.7 |
| Wlogp | 4.62 |
| Mlogp | 3.4 |
| Silicos-it log p | 3.82 |
| Consensus log p | 4.09 |
| Esol log s | -5.65 |
| Esol solubility (mg/ml) | 0.000971 |
| Esol solubility (mol/l) | 0.00000222 |
| Esol class | Moderately |
| Ali log s | -6.02 |
| Ali solubility (mg/ml) | 0.00042 |
| Ali solubility (mol/l) | 0.00000096 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.96 |
| Silicos-it solubility (mg/ml) | 0.00000481 |
| Silicos-it solubility (mol/l) | 0.00000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.62 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.03 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.705 |
| Logd | 3.434 |
| Logp | 4.115 |
| F (20%) | 0.003 |
| F (30%) | 0.002 |
| Mdck | 2.19E-05 |
| Ppb | 0.9885 |
| Vdss | 0.367 |
| Fu | 0.0196 |
| Cyp1a2-inh | 0.759 |
| Cyp1a2-sub | 0.118 |
| Cyp2c19-inh | 0.935 |
| Cyp2c19-sub | 0.116 |
| Cl | 6.208 |
| T12 | 0.238 |
| H-ht | 0.909 |
| Dili | 0.979 |
| Roa | 0.064 |
| Fdamdd | 0.959 |
| Skinsen | 0.214 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.053 |
| Bcf | 1.211 |
| Igc50 | 3.994 |
| Lc50 | 4.843 |
| Lc50dm | 4.648 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.202 |
| Nr-ahr | 0.916 |
| Nr-aromatase | 0.95 |
| Nr-er | 0.536 |
| Nr-er-lbd | 0.019 |
| Nr-ppar-gamma | 0.932 |
| Sr-are | 0.808 |
| Sr-atad5 | 0.39 |
| Sr-hse | 0.32 |
| Sr-mmp | 0.892 |
| Sr-p53 | 0.924 |
| Vol | 414.764 |
| Dense | 1.049 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 3 |
| Qed | 0.49 |
| Synth | 2.466 |
| Fsp3 | 0.045 |
| Mce-18 | 22 |
| Natural product-likeness | -2.105 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |