| General Information | |
|---|---|
| ZINC ID | ZINC000014975661 |
| Molecular Weight (Da) | 397 |
| SMILES | Cc1c(C(=O)NCC2CCCCC2)nn(-c2ccc(Cl)cc2)c1-n1cccc1 |
| Molecular Formula | C22Cl1N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.033 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 5.26 |
| Activity (Ki) in nM | 389.045 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.99642235 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.36 |
| Ilogp | 4.17 |
| Xlogp3 | 5.6 |
| Wlogp | 4.93 |
| Mlogp | 4.03 |
| Silicos-it log p | 3.77 |
| Consensus log p | 4.5 |
| Esol log s | -5.86 |
| Esol solubility (mg/ml) | 0.000553 |
| Esol solubility (mol/l) | 0.00000139 |
| Esol class | Moderately |
| Ali log s | -6.45 |
| Ali solubility (mg/ml) | 0.00014 |
| Ali solubility (mol/l) | 0.00000035 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.6 |
| Silicos-it solubility (mg/ml) | 0.0001 |
| Silicos-it solubility (mol/l) | 0.00000025 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.75 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.18 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.059 |
| Logd | 4.253 |
| Logp | 5.598 |
| F (20%) | 0.003 |
| F (30%) | 0.006 |
| Mdck | 1.67E-05 |
| Ppb | 0.9818 |
| Vdss | 1.053 |
| Fu | 0.0209 |
| Cyp1a2-inh | 0.559 |
| Cyp1a2-sub | 0.548 |
| Cyp2c19-inh | 0.941 |
| Cyp2c19-sub | 0.325 |
| Cl | 1.399 |
| T12 | 0.087 |
| H-ht | 0.388 |
| Dili | 0.887 |
| Roa | 0.081 |
| Fdamdd | 0.787 |
| Skinsen | 0.21 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.096 |
| Bcf | 2.413 |
| Igc50 | 4.658 |
| Lc50 | 5.337 |
| Lc50dm | 4.582 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.912 |
| Nr-aromatase | 0.973 |
| Nr-er | 0.466 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.031 |
| Sr-are | 0.814 |
| Sr-atad5 | 0.231 |
| Sr-hse | 0.571 |
| Sr-mmp | 0.834 |
| Sr-p53 | 0.87 |
| Vol | 401.739 |
| Dense | 0.986 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.664 |
| Synth | 2.462 |
| Fsp3 | 0.364 |
| Mce-18 | 50.4 |
| Natural product-likeness | -1.68 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |