| General Information | |
|---|---|
| ZINC ID | ZINC000014975678 |
| Molecular Weight (Da) | 417 |
| SMILES | Cc1c(C(=O)NC2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-n1cccc1 |
| Molecular Formula | C21Cl2N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.106 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| LogP | 5.594 |
| Activity (Ki) in nM | 64.565 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.991 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.12 |
| Xlogp3 | 5.67 |
| Wlogp | 5.34 |
| Mlogp | 4.29 |
| Silicos-it log p | 4.01 |
| Consensus log p | 4.69 |
| Esol log s | -6.09 |
| Esol solubility (mg/ml) | 0.000337 |
| Esol solubility (mol/l) | 0.0000008 |
| Esol class | Poorly sol |
| Ali log s | -6.52 |
| Ali solubility (mg/ml) | 0.000125 |
| Ali solubility (mol/l) | 0.00000029 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.79 |
| Silicos-it solubility (mg/ml) | 0.0000674 |
| Silicos-it solubility (mol/l) | 0.00000016 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.82 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.301 |
| Logd | 4.282 |
| Logp | 5.476 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 1.37E-05 |
| Ppb | 0.982 |
| Vdss | 0.98 |
| Fu | 0.0226 |
| Cyp1a2-inh | 0.513 |
| Cyp1a2-sub | 0.607 |
| Cyp2c19-inh | 0.936 |
| Cyp2c19-sub | 0.49 |
| Cl | 2.367 |
| T12 | 0.078 |
| H-ht | 0.356 |
| Dili | 0.951 |
| Roa | 0.135 |
| Fdamdd | 0.859 |
| Skinsen | 0.246 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.141 |
| Bcf | 1.759 |
| Igc50 | 4.374 |
| Lc50 | 5.2 |
| Lc50dm | 4.697 |
| Nr-ar | 0.027 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.915 |
| Nr-aromatase | 0.971 |
| Nr-er | 0.695 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.81 |
| Sr-are | 0.875 |
| Sr-atad5 | 0.473 |
| Sr-hse | 0.51 |
| Sr-mmp | 0.899 |
| Sr-p53 | 0.934 |
| Vol | 399.654 |
| Dense | 1.041 |
| Flex | 0.217 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.623 |
| Synth | 2.527 |
| Fsp3 | 0.333 |
| Mce-18 | 53.429 |
| Natural product-likeness | -1.78 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |