| General Information | |
|---|---|
| ZINC ID | ZINC000014975701 |
| Molecular Weight (Da) | 522 |
| SMILES | Cc1c(C(=O)NCc2ccc(Cl)c(Cl)c2)nn(-c2ccc(Cl)c(Cl)c2)c1-n1c(C)ccc1C |
| Molecular Formula | C24Cl4N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 134.114 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 7.213 |
| Activity (Ki) in nM | 1380.384 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.19662118 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.17 |
| Ilogp | 4.97 |
| Xlogp3 | 7.41 |
| Wlogp | 6.98 |
| Mlogp | 5.64 |
| Silicos-it log p | 6.64 |
| Consensus log p | 6.33 |
| Esol log s | -7.84 |
| Esol solubility (mg/ml) | 0.00000749 |
| Esol solubility (mol/l) | 1.43E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.33 |
| Ali solubility (mg/ml) | 0.00000245 |
| Ali solubility (mol/l) | 4.68E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.17 |
| Silicos-it solubility (mg/ml) | 3.51E-08 |
| Silicos-it solubility (mol/l) | 6.71E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.22 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.41 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.83 |
| Logd | 3.367 |
| Logp | 6.231 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 7.85E-06 |
| Ppb | 1.0004 |
| Vdss | 0.344 |
| Fu | 0.0178 |
| Cyp1a2-inh | 0.463 |
| Cyp1a2-sub | 0.948 |
| Cyp2c19-inh | 0.902 |
| Cyp2c19-sub | 0.71 |
| Cl | 4.596 |
| T12 | 0.143 |
| H-ht | 0.302 |
| Dili | 0.941 |
| Roa | 0.813 |
| Fdamdd | 0.946 |
| Skinsen | 0.047 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.103 |
| Bcf | 3.811 |
| Igc50 | 5.252 |
| Lc50 | 6.612 |
| Lc50dm | 6.566 |
| Nr-ar | 0.104 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.62 |
| Nr-aromatase | 0.924 |
| Nr-er | 0.657 |
| Nr-er-lbd | 0.069 |
| Nr-ppar-gamma | 0.14 |
| Sr-are | 0.905 |
| Sr-atad5 | 0.538 |
| Sr-hse | 0.036 |
| Sr-mmp | 0.875 |
| Sr-p53 | 0.867 |
| Vol | 474.055 |
| Dense | 1.097 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.303 |
| Synth | 2.58 |
| Fsp3 | 0.167 |
| Mce-18 | 26 |
| Natural product-likeness | -1.68 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |