| General Information | |
|---|---|
| ZINC ID | ZINC000014975722 |
| Molecular Weight (Da) | 489 |
| SMILES | Cc1c(C(=O)NCc2ccc(Cl)c(Cl)c2)nn(-c2ccc(F)cc2F)c1-n1c(C)ccc1C |
| Molecular Formula | C24Cl2F2N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.938 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 6.296 |
| Activity (Ki) in nM | 3981.072 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.175 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.17 |
| Ilogp | 4.69 |
| Xlogp3 | 6.35 |
| Wlogp | 6.79 |
| Mlogp | 5.44 |
| Silicos-it log p | 6.2 |
| Consensus log p | 5.89 |
| Esol log s | -6.97 |
| Esol solubility (mg/ml) | 0.0000522 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -7.23 |
| Ali solubility (mg/ml) | 0.0000289 |
| Ali solubility (mol/l) | 0.00000005 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.54 |
| Silicos-it solubility (mg/ml) | 0.00000014 |
| Silicos-it solubility (mol/l) | 2.90E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.78 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.37 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.327 |
| Logd | 3.643 |
| Logp | 5.576 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 1.28E-05 |
| Ppb | 0.9863 |
| Vdss | 0.292 |
| Fu | 0.0154 |
| Cyp1a2-inh | 0.193 |
| Cyp1a2-sub | 0.948 |
| Cyp2c19-inh | 0.923 |
| Cyp2c19-sub | 0.855 |
| Cl | 5.05 |
| T12 | 0.147 |
| H-ht | 0.282 |
| Dili | 0.905 |
| Roa | 0.426 |
| Fdamdd | 0.958 |
| Skinsen | 0.043 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.233 |
| Bcf | 2.986 |
| Igc50 | 4.951 |
| Lc50 | 6.028 |
| Lc50dm | 7.118 |
| Nr-ar | 0.161 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.484 |
| Nr-aromatase | 0.939 |
| Nr-er | 0.306 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.434 |
| Sr-are | 0.812 |
| Sr-atad5 | 0.057 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.528 |
| Sr-p53 | 0.606 |
| Vol | 455.768 |
| Dense | 1.071 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.368 |
| Synth | 2.602 |
| Fsp3 | 0.167 |
| Mce-18 | 26 |
| Natural product-likeness | -1.936 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |